Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N598672-1g
|
1g |
3
|
$12.90
|
|
|
N598672-5g
|
5g |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$40.90
|
|
|
N598672-25g
|
25g |
2
|
$128.90
|
|
|
N598672-100g
|
100g |
2
|
$472.90
|
|
| Synonyms | Boc-D-norvaline | 57521-85-4 | Boc-D-Nva-OH | (R)-2-((tert-Butoxycarbonyl)amino)pentanoic acid | D-Norvaline, N-[(1,1-dimethylethoxy)carbonyl]- | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid | MFCD00155638 | SCHEMBL3450517 | DTXSID20426405 | INWOAUUPYIXDHN- |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives |
| Direct Parent | Alpha amino acids and derivatives |
| Alternative Parents | Methyl-branched fatty acids Carbamate esters Monocarboxylic acids and derivatives Carboxylic acids Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Alpha-amino acid or derivatives - Branched fatty acid - Methyl-branched fatty acid - Fatty acyl - Fatty acid - Carbamic acid ester - Carboxylic acid - Monocarboxylic acid or derivatives - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Carbonyl group - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| INCHI | InChI=1S/C10H19NO4/c1-5-6-7(8(12)13)11-9(14)15-10(2,3)4/h7H,5-6H2,1-4H3,(H,11,14)(H,12,13)/t7-/m1/s1 |
| InChIKey | INWOAUUPYIXDHN-SSDOTTSWSA-N |
| Smiles | CCCC(C(=O)O)NC(=O)OC(C)(C)C |
| Isomeric SMILES | CCC[C@H](C(=O)O)NC(=O)OC(C)(C)C |
| WGK Germany | 3 |
| Molecular Weight | 217.26 |
| Beilstein | 5260625 |
| Reaxy-Rn | 5850968 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=5850968&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Aug 14, 2023 | N598672 | |
| Certificate of Analysis | Aug 14, 2023 | N598672 | |
| Certificate of Analysis | Aug 14, 2023 | N598672 | |
| Certificate of Analysis | Aug 14, 2023 | N598672 |
| Molecular Weight | 217.260 g/mol |
|---|---|
| XLogP3 | 1.800 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 6 |
| Exact Mass | 217.131 Da |
| Monoisotopic Mass | 217.131 Da |
| Topological Polar Surface Area | 75.600 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 232.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |