Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B152720-250mg
|
250mg |
2
|
$39.90
|
|
|
B152720-1g
|
1g |
2
|
$121.90
|
|
| Synonyms | AKOS015839998 | MFCD09038502 | T70729 | DTXSID30471401 | Bis(trimethylsilyl)bromomethane | (bromomethylene)bis(trimethylsilane) | B2874 | Bis(trimethylsilyl)methyl Bromide | MYXGYPFZVNSVCB-UHFFFAOYSA-N | [bromo(trimethylsilyl)methyl]-trimethylsilane |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Class | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Alkylsilanes |
| Direct Parent | Trialkylsilanes |
| Alternative Parents | Organic metalloid salts Organobromides Hydrocarbon derivatives Alkyl bromides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Trialkylsilane - Organic metalloid salt - Hydrocarbon derivative - Organobromide - Organohalogen compound - Alkyl halide - Alkyl bromide - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as trialkylsilanes. These are organosilicon compounds containing exactly one alkyl chain attached to the silicon atom. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504766688 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504766688 |
| IUPAC Name | [bromo(trimethylsilyl)methyl]-trimethylsilane |
| INCHI | InChI=1S/C7H19BrSi2/c1-9(2,3)7(8)10(4,5)6/h7H,1-6H3 |
| InChIKey | MYXGYPFZVNSVCB-UHFFFAOYSA-N |
| Smiles | C[Si](C)(C)C([Si](C)(C)C)Br |
| Isomeric SMILES | C[Si](C)(C)C([Si](C)(C)C)Br |
| Molecular Weight | 239.3 |
| Reaxy-Rn | 2321946 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2321946&ln= |
| Sensitivity | Moisture Sensitive,Heat Sensitive |
|---|---|
| Refractive Index | 1.47 |
| Molecular Weight | 239.300 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 2 |
| Exact Mass | 238.021 Da |
| Monoisotopic Mass | 238.021 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 95.800 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |