Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B152072-200mg
|
200mg |
2
|
$137.90
|
|
| Synonyms | DFTPP, | Phosphine, bis(pentafluorophenyl)phenyl- | bis(2,3,4,5,6-pentafluorophenyl)-phenylphosphane | DTXSID90198783 | MFCD00000291 | Bis(perfluorophenyl)(phenyl)phosphine | T70977 | Decafluorotriphenylphosphine (DFTPP) SV Tuning 1000 microg/mL in Aceton |
|---|---|
| Specifications & Purity | ≥98%(GC) |
| Storage Temp | Argon charged |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Phenylphosphines and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylphosphines and derivatives |
| Alternative Parents | Fluorobenzenes Aryl fluorides Organic phosphines and derivatives Organopnictogen compounds Organofluorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Triphenylphosphine - Phenylphosphine - Halobenzene - Fluorobenzene - Aryl halide - Aryl fluoride - Phosphine - Organopnictogen compound - Hydrocarbon derivative - Organophosphorus compound - Organofluoride - Organohalogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylphosphines and derivatives. These are compounds containing a phenylphosphine, which consists of phosphine substituent bound to a phenyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)-phenylphosphane |
|---|---|
| INCHI | InChI=1S/C18H5F10P/c19-7-9(21)13(25)17(14(26)10(7)22)29(6-4-2-1-3-5-6)18-15(27)11(23)8(20)12(24)16(18)28/h1-5H |
| InChIKey | OYNXPGGNQMSMTR-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C=C1)P(C2=C(C(=C(C(=C2F)F)F)F)F)C3=C(C(=C(C(=C3F)F)F)F)F |
| Isomeric SMILES | C1=CC=C(C=C1)P(C2=C(C(=C(C(=C2F)F)F)F)F)C3=C(C(=C(C(=C3F)F)F)F)F |
| Molecular Weight | 442.2 |
| Reaxy-Rn | 949443 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=949443&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Feb 20, 2024 | B152072 |
| Solubility | Soluble in chloroform, dichloromethane, tetrahydrofuran, benzene, toluene, ethanol, methanol, and supercritical carbon dioxide. |
|---|---|
| Sensitivity | Air sensitive |
| Boil Point(°C) | 105 °C/0.3 mmHg |
| Melt Point(°C) | 58°C-62°C |
| Molecular Weight | 442.200 g/mol |
| XLogP3 | 5.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 10 |
| Rotatable Bond Count | 3 |
| Exact Mass | 441.997 Da |
| Monoisotopic Mass | 441.997 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 29 |
| Formal Charge | 0 |
| Complexity | 479.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |