Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B282386-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$69.90
|
|
CVD & ALD Precursors
| Synonyms | Bis(benzene)chromium(0), 97% | benzene;chromium | Chromium, bis(benzene)-(8CI) | Q421390 | bis(benzene) chromium | Dibenzolchrom | Chromium dibenzene | Chromium, bis(benzene)- (8CI) | DTXSID40155402 | Bis(benzene)chromium(0) | Dibenzenechromium | MFCD0001 |
|---|---|
| Specifications & Purity | ≥97% |
| Product Description |
Catalyst for: |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzene and substituted derivatives |
| Alternative Parents | Aromatic hydrocarbons Unsaturated hydrocarbons Hydrocarbon derivatives |
| Molecular Framework | Not available |
| Substituents | Monocyclic benzene moiety - Aromatic hydrocarbon - Unsaturated hydrocarbon - Hydrocarbon derivative - Hydrocarbon - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzene and substituted derivatives. These are aromatic compounds containing one monocyclic ring system consisting of benzene. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | benzene;chromium |
|---|---|
| INCHI | InChI=1S/2C6H6.Cr/c2*1-2-4-6-5-3-1;/h2*1-6H; |
| InChIKey | HVURSIGIEONDKB-UHFFFAOYSA-N |
| Smiles | C1=CC=CC=C1.C1=CC=CC=C1.[Cr] |
| Isomeric SMILES | C1=CC=CC=C1.C1=CC=CC=C1.[Cr] |
| Molecular Weight | 208.22 |
| Reaxy-Rn | 13954572 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=13954572&ln= |
| Sensitivity | air sensitive |
|---|---|
| Melt Point(°C) | 284-285°C |
| Molecular Weight | 208.220 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 208.034 Da |
| Monoisotopic Mass | 208.034 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 15.500 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |