Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B167205-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$410.90
|
|
Discover BIS-(3,5,5-TRIMETHYLHEXYL) PHTHALATE by Aladdin Scientific in for only $410.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | Bis(3,5,5-trimethylhexyl) phthalate | 14103-61-8 | bis(3,5,5-trimethylhexyl) benzene-1,2-dicarboxylate | alpha-Dinonyl phthalate | 1,2-Benzenedicarboxylicacid, 1,2-bis(3,5,5-trimethylhexyl) ester | 19ND350H65 | 1,2-Benzenedicarboxylic acid, bis(3,5,5-trimethylhexyl) |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzoic acid esters |
| Alternative Parents | Benzoyl derivatives Dicarboxylic acids and derivatives Carboxylic acid esters Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzoate ester - Benzoyl - Dicarboxylic acid or derivatives - Carboxylic acid ester - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzoic acid esters. These are ester derivatives of benzoic acid. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | bis(3,5,5-trimethylhexyl) benzene-1,2-dicarboxylate |
|---|---|
| INCHI | InChI=1S/C26H42O4/c1-19(17-25(3,4)5)13-15-29-23(27)21-11-9-10-12-22(21)24(28)30-16-14-20(2)18-26(6,7)8/h9-12,19-20H,13-18H2,1-8H3 |
| InChIKey | GDJOUZYAIHWDCA-UHFFFAOYSA-N |
| Smiles | CC(CCOC(=O)C1=CC=CC=C1C(=O)OCCC(C)CC(C)(C)C)CC(C)(C)C |
| Isomeric SMILES | CC(CCOC(=O)C1=CC=CC=C1C(=O)OCCC(C)CC(C)(C)C)CC(C)(C)C |
| Molecular Weight | 418.622 |
| Reaxy-Rn | 2479003 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2479003&ln= |
| Molecular Weight | 418.600 g/mol |
|---|---|
| XLogP3 | 9.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 14 |
| Exact Mass | 418.308 Da |
| Monoisotopic Mass | 418.308 Da |
| Topological Polar Surface Area | 52.600 Ų |
| Heavy Atom Count | 30 |
| Formal Charge | 0 |
| Complexity | 478.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |