Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B346440-25mg
|
25mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$769.90
|
|
a chemical used in the preparation of antidiabetic agents
| Synonyms | [6-(hydroxymethyl)-1,4-dioxan-2-yl]methanol | 1,4-Dioxane-2,6-dimethanol | DXBFGULPNNFLAV-UHFFFAOYSA-N | (1,4-Dioxane-2,6-diyl)dimethanol | p-Dioxane-2,6-dimethanol | 2,6-bis(hydroxymethyl) dioxane | FT-0663297 | DTXSID20337860 | AKOS022504676 | Bis(2,6-h |
|---|---|
| Storage Temp | Store at -20°C |
| Shipped In |
Ice chest + Ice pads This product requires cold chain shipping. Ground and other economy services are not available. |
| Product Description |
Bis(2,6-hydroxymethyl)dioxane is used in the preparation of antidiabetic agents comprising analgesic or anti-inflammatory drugs. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Dioxanes |
| Subclass | 1,4-dioxanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 1,4-dioxanes |
| Alternative Parents | Oxacyclic compounds Dialkyl ethers Primary alcohols Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Para-dioxane - Oxacycle - Ether - Dialkyl ether - Organic oxygen compound - Hydrocarbon derivative - Primary alcohol - Organooxygen compound - Alcohol - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 1,4-dioxanes. These are organic compounds containing 1,4-dioxane, an aliphatic six-member ring with two oxygen atoms in ring positions 1 and 4. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | [6-(hydroxymethyl)-1,4-dioxan-2-yl]methanol |
|---|---|
| INCHI | InChI=1S/C6H12O4/c7-1-5-3-9-4-6(2-8)10-5/h5-8H,1-4H2 |
| InChIKey | DXBFGULPNNFLAV-UHFFFAOYSA-N |
| Smiles | C1C(OC(CO1)CO)CO |
| Isomeric SMILES | C1C(OC(CO1)CO)CO |
| Molecular Weight | 148.16 |
| Reaxy-Rn | 105956 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=105956&ln= |
| Molecular Weight | 148.160 g/mol |
|---|---|
| XLogP3 | -1.500 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 148.074 Da |
| Monoisotopic Mass | 148.074 Da |
| Topological Polar Surface Area | 58.900 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 85.700 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |