Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B331340-25mg
|
25mg |
2
|
$199.90
|
|
|
B331340-100mg
|
100mg |
1
|
$529.90
|
|
| Synonyms | 2,5,8,11,14,19,22,25,28,31-Decaoxatricyclo[30.2.2.2(15,18)]octatriconta-15,17,32,34,35,37-hexadiene | D88915 | MFCD02066192 | Bis(1,4-phenylene)-34-crown 10-Ether | 2,5,8,11,14,19,22,25,28,31-decaoxa-tricyclo[30,2,2,2 15,18]octatriaconta-1(34),15,17,32,35 |
|---|---|
| Storage Temp | Store at 2-8°C,Protected from light |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Ethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkyl aryl ethers |
| Alternative Parents | Benzenoids Oxacyclic compounds Dialkyl ethers Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Alkyl aryl ether - Benzenoid - Oxacycle - Organoheterocyclic compound - Dialkyl ether - Hydrocarbon derivative - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkyl aryl ethers. These are organic compounds containing the alkyl aryl ether functional group with the generic formula R-O-R' , where R is an alkyl group and R' is an aryl group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504759607 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504759607 |
| IUPAC Name | 2,5,8,11,14,19,22,25,28,31-decaoxatricyclo[30.2.2.215,18]octatriaconta-1(35),15,17,32(36),33,37-hexaene |
| INCHI | InChI=1S/C28H40O10/c1-2-26-4-3-25(1)35-21-17-31-13-9-29-11-15-33-19-23-37-27-5-7-28(8-6-27)38-24-20-34-16-12-30-10-14-32-18-22-36-26/h1-8H,9-24H2 |
| InChIKey | REKDBTBSNFSNGP-UHFFFAOYSA-N |
| Smiles | C1COCCOC2=CC=C(C=C2)OCCOCCOCCOCCOC3=CC=C(C=C3)OCCOCCO1 |
| Isomeric SMILES | C1COCCOC2=CC=C(C=C2)OCCOCCOCCOCCOC3=CC=C(C=C3)OCCOCCO1 |
| Molecular Weight | 536.61 |
| Reaxy-Rn | 1632594 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1632594&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jul 10, 2023 | B331340 | |
| Certificate of Analysis | Jul 10, 2023 | B331340 | |
| Certificate of Analysis | Jul 10, 2023 | B331340 | |
| Certificate of Analysis | Jul 10, 2023 | B331340 |
| Sensitivity | Light sensitive |
|---|---|
| Melt Point(°C) | 69.0 to 73.0 °C |
| Molecular Weight | 536.600 g/mol |
| XLogP3 | 2.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 10 |
| Rotatable Bond Count | 0 |
| Exact Mass | 536.262 Da |
| Monoisotopic Mass | 536.262 Da |
| Topological Polar Surface Area | 92.300 Ų |
| Heavy Atom Count | 38 |
| Formal Charge | 0 |
| Complexity | 434.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |