Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B635029-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$153.90
|
|
|
B635029-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$259.90
|
|
|
B635029-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$432.90
|
|
|
B635029-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$648.90
|
|
|
B635029-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,246.90
|
|
| Synonyms | bicyclo[4.1.0]heptan-7-amine hydrochloride | 89894-85-9 | bicyclo[4.1.0]heptan-7-amine | hydrochloride | Bicyclo[4.1.0]heptan-7-amine HCl | MFCD21602801 | AKOS024015560 | PB43786 | AS-78076 | bicyclo[4.1.0]heptan-7-aminehydrochloride | EN300-99289 | P1802 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Primary amines |
| Direct Parent | Monoalkylamines |
| Alternative Parents | Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Hydrocarbon derivative - Hydrochloride - Primary aliphatic amine - Aliphatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as monoalkylamines. These are organic compounds containing an primary aliphatic amine group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | bicyclo[4.1.0]heptan-7-amine;hydrochloride |
|---|---|
| INCHI | InChI=1S/C7H13N.ClH/c8-7-5-3-1-2-4-6(5)7;/h5-7H,1-4,8H2;1H |
| InChIKey | DHFFJAHGRGPJSA-UHFFFAOYSA-N |
| Smiles | C1CCC2C(C1)C2N.Cl |
| Isomeric SMILES | C1CCC2C(C1)C2N.Cl |
| PubChem CID | 72135075 |
| Molecular Weight | 147.640 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 147.081 Da |
| Monoisotopic Mass | 147.081 Da |
| Topological Polar Surface Area | 26.000 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 88.600 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |