Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A118667-100mg
|
100mg |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$239.90
|
|
| Synonyms | NCGC00163967-03 | NSC59821 | NSC-59821 | Tox21_201825 | AC-26296 | InChI=1/C12H8/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-8 | NCGC00163967-02 | ACENAPHTHYLENE [HSDB] | Acenaphthylene 100 microg/mL in Acetonitrile | AKOS015901063 | HY-W013570 | DS-16915 | A81 |
|---|---|
| Specifications & Purity | analytical standard |
| Shipped In | Normal |
| Grade | analytical standard |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Acenaphthylenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Acenaphthylenes |
| Alternative Parents | Naphthalenes Aromatic hydrocarbons Polycyclic hydrocarbons Cyclic olefins |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Acenaphthylene - Naphthalene - Aromatic hydrocarbon - Polycyclic hydrocarbon - Cyclic olefin - Unsaturated hydrocarbon - Olefin - Hydrocarbon - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as acenaphthylenes. These are aromatic polycyclic compounds containing an acenaphthylene moiety. Acenaphthylene is a carbotricyclic compound, consisting of a naphthalene with positions C1 and C8 connected by an ethylene bridge. |
| External Descriptors | ortho- and peri-fused polycyclic arene - acenaphthylenes - ortho- and peri-fused tricyclic hydrocarbon |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | acenaphthylene |
|---|---|
| INCHI | InChI=1S/C12H8/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-8H |
| InChIKey | HXGDTGSAIMULJN-UHFFFAOYSA-N |
| Smiles | C1=CC2=C3C(=C1)C=CC3=CC=C2 |
| Isomeric SMILES | C1=CC2=C3C(=C1)C=CC3=CC=C2 |
| Molecular Weight | 152.19 |
| Reaxy-Rn | 774092 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=774092&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Feb 18, 2022 | A118667 |
| Flash Point(°F) | 251.6 °F |
|---|---|
| Flash Point(°C) | 122.0 °C |
| Boil Point(°C) | 280 °C |
| Melt Point(°C) | 78-82 °C |
| Molecular Weight | 152.190 g/mol |
| XLogP3 | 3.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 152.063 Da |
| Monoisotopic Mass | 152.063 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 184.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |