Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A151190-10mg
|
10mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$638.90
|
|
| Synonyms | Hnj cpd | alpha-Homoallonojirimycin | AS-71348 | Homonojirimycin | Homo-nojirimycin | 2,6-bis(hydroxymethyl)piperidine-3,4,5-triol | BB 0220378 | alpha-Homonojirimycin, >=98.0% (TLC) | BDBM50259956 | BDBM50403720 | (2r,3r,5s,6r)-2,6-bis(hydroxymethyl)pipe |
|---|---|
| Specifications & Purity | ≥98%(HPLC) |
| Storage Temp | Store at -20°C |
| Shipped In |
Ice chest + Ice pads This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidines |
| Alternative Parents | Secondary alcohols 1,2-aminoalcohols Polyols Dialkylamines Azacyclic compounds Primary alcohols Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Piperidine - 1,2-aminoalcohol - Secondary alcohol - Secondary aliphatic amine - Polyol - Secondary amine - Azacycle - Primary alcohol - Alcohol - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Organopnictogen compound - Amine - Hydrocarbon derivative - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidines. These are compounds containing a piperidine ring, which is a saturated aliphatic six-member ring with one nitrogen atom and five carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (2R,3S,5R,6R)-2,6-bis(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| INCHI | InChI=1S/C7H15NO5/c9-1-3-5(11)7(13)6(12)4(2-10)8-3/h3-13H,1-2H2/t3-,4-,5-,6+,7?/m1/s1 |
| InChIKey | CLVUFWXGNIFGNC-QTSLKERKSA-N |
| Smiles | C(C1C(C(C(C(N1)CO)O)O)O)O |
| Isomeric SMILES | C([C@@H]1[C@H](C([C@H]([C@H](N1)CO)O)O)O)O |
| Molecular Weight | 193.2 |
| Reaxy-Rn | 24713573 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=24713573&ln= |
| Melt Point(°C) | 207°C(lit.) |
|---|---|
| Molecular Weight | 193.200 g/mol |
| XLogP3 | -2.400 |
| Hydrogen Bond Donor Count | 6 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 2 |
| Exact Mass | 193.095 Da |
| Monoisotopic Mass | 193.095 Da |
| Topological Polar Surface Area | 113.000 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 151.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |