Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
H156856-250mg
|
250mg |
3
|
$84.90
|
|
|
H156856-1g
|
1g |
2
|
$260.90
|
|
| Synonyms | H0970 | NSC133908 | NSC-133908 | 2-(9-anthracenyl)ethanol | 2-(9-Anthryl)ethanol | 2-(9--anthryl)ethanol | AS-58511 | 2-(9-Anthryl)ethanol, AldrichCPR | DTXSID70299969 | A870552 | 2-anthracen-9-ylethanol | AKOS015856533 | MFCD01318099 | 2-(Anthracen-9-yl) |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Anthracenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Anthracenes |
| Alternative Parents | Primary alcohols Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Anthracene - Organic oxygen compound - Hydrocarbon derivative - Primary alcohol - Organooxygen compound - Alcohol - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as anthracenes. These are organic compounds containing a system of three linearly fused benzene rings. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504758290 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504758290 |
| IUPAC Name | 2-anthracen-9-ylethanol |
| INCHI | InChI=1S/C16H14O/c17-10-9-16-14-7-3-1-5-12(14)11-13-6-2-4-8-15(13)16/h1-8,11,17H,9-10H2 |
| InChIKey | KLNMQYHQWUWCPG-UHFFFAOYSA-N |
| Smiles | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2CCO |
| Isomeric SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2CCO |
| Molecular Weight | 222.29 |
| Reaxy-Rn | 2416996 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2416996&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Oct 10, 2023 | H156856 | |
| Certificate of Analysis | Oct 10, 2023 | H156856 | |
| Certificate of Analysis | Oct 10, 2023 | H156856 | |
| Certificate of Analysis | Oct 10, 2023 | H156856 |
| Melt Point(°C) | 125 °C |
|---|---|
| Molecular Weight | 222.280 g/mol |
| XLogP3 | 4.300 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 222.104 Da |
| Monoisotopic Mass | 222.104 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 228.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |