Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M172253-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,534.90
|
|
Discover 7-methyl-7-azaspiro[3.5]nonan-2-amine by Aladdin Scientific in 97% for only $2,534.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1160247-16-4 | 2-Amino-7-methyl-7-azaspiro[3.5]nonane | 7-methyl-7-azaspiro[3.5]nonan-2-amine | MFCD12198555 | SCHEMBL17888424 | DTXSID101285268 | AKOS024438383 | PB13520 | AS-34374 | SY097605 | 7-Azaspiro[3.5]nonan-2-amine, 7-methyl- | CS-0049996 | A893669 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidines |
| Alternative Parents | Trialkylamines Azacyclic compounds Monoalkylamines Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Piperidine - Tertiary aliphatic amine - Tertiary amine - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Primary aliphatic amine - Amine - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidines. These are compounds containing a piperidine ring, which is a saturated aliphatic six-member ring with one nitrogen atom and five carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 7-methyl-7-azaspiro[3.5]nonan-2-amine |
|---|---|
| INCHI | InChI=1S/C9H18N2/c1-11-4-2-9(3-5-11)6-8(10)7-9/h8H,2-7,10H2,1H3 |
| InChIKey | BEIQGPFZUFUANC-UHFFFAOYSA-N |
| Smiles | CN1CCC2(CC1)CC(C2)N |
| Isomeric SMILES | CN1CCC2(CC1)CC(C2)N |
| Molecular Weight | 154.257 |
| Reaxy-Rn | 40109697 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=40109697&ln= |
| Molecular Weight | 154.250 g/mol |
|---|---|
| XLogP3 | 0.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 154.147 Da |
| Monoisotopic Mass | 154.147 Da |
| Topological Polar Surface Area | 29.300 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 140.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |