Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
F637648-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$583.90
|
|
| Synonyms | IJPUKUSYXQAGHU-UHFFFAOYSA-N | 4H-Pyrido[1,2-a]pyrimidin-4-one, 7-fluoro-2-hydroxy- | MFCD28365090 | A937539 | AKOS037648741 | 7-fluoro-2-hydroxy-4H-pyrido[1,2-a]pyrimidin-4-one | 1449598-85-9 | 7-fluoro-2-hydroxypyrido[1,2-a]pyrimidin-4-one | E73565 | BS- |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridopyrimidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridopyrimidines |
| Alternative Parents | Pyrimidones Hydroxypyrimidines Pyridines and derivatives Aryl fluorides Vinylogous acids Heteroaromatic compounds Lactams Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyridopyrimidine - Hydroxypyrimidine - Pyrimidone - Pyrimidine - Pyridine - Aryl halide - Aryl fluoride - Heteroaromatic compound - Vinylogous acid - Lactam - Azacycle - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridopyrimidines. These are compounds containing a pyridopyrimidine, which consists of a pyridine fused to a pyrimidine. Pyridine is 6-membered ring consisting of five carbon atoms and a nitrogen atom. Pyrimidine is a 6-membered ring consisting of four carbon atoms and two nitrogen centers at the 1- and 3- ring positions. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 7-fluoro-2-hydroxypyrido[1,2-a]pyrimidin-4-one |
|---|---|
| INCHI | InChI=1S/C8H5FN2O2/c9-5-1-2-6-10-7(12)3-8(13)11(6)4-5/h1-4,12H |
| InChIKey | IJPUKUSYXQAGHU-UHFFFAOYSA-N |
| Smiles | C1=CC2=NC(=CC(=O)N2C=C1F)O |
| Isomeric SMILES | C1=CC2=NC(=CC(=O)N2C=C1F)O |
| Alternate CAS | 1449598-85-9 |
| PubChem CID | 136629818 |
| Molecular Weight | 180.14 |
| Molecular Weight | 180.140 g/mol |
|---|---|
| XLogP3 | -0.100 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 180.034 Da |
| Monoisotopic Mass | 180.034 Da |
| Topological Polar Surface Area | 52.900 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 393.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |