Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C177121-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,802.90
|
|
| Synonyms | 7-chloro-1H-imidazo[4,5-c]pyridin-4-amine | 668268-69-7 | 1H-Imidazo[4,5-c]pyridin-4-amine, 7-chloro- | 7-chloro-3H-imidazo[4,5-c]pyridin-4-amine | SCHEMBL17253699 | DTXSID901270566 | AMY33996 | MFCD18803252 | AKOS025146823 | SB11875 | AS-34026 | CS-0050054 | 1H-Imidazo[4,5-c]py |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Imidazopyridines |
| Subclass | Imidazo-[4,5-c]pyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Imidazo-[4,5-c]pyridines |
| Alternative Parents | Aminopyridines and derivatives Imidolactams Aryl chlorides Imidazoles Heteroaromatic compounds Azacyclic compounds Primary amines Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Imidazo-[4,5-c]pyridine - Aminopyridine - Aryl chloride - Aryl halide - Pyridine - Imidolactam - Imidazole - Azole - Heteroaromatic compound - Azacycle - Primary amine - Organonitrogen compound - Organochloride - Organohalogen compound - Organic nitrogen compound - Hydrocarbon derivative - Amine - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as imidazo-[4,5-c]pyridines. These are organic heterocyclic compounds containing an imidazo-[4,5-c]pyridine ring system. Imidazo-[4,5-c]pyridine consists of an imidazole ring fused to a pyridine, so that the three ring nitrogen atoms are at the 1-, 2-, and 5-position, respectively. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 7-chloro-3H-imidazo[4,5-c]pyridin-4-amine |
|---|---|
| INCHI | InChI=1S/C6H5ClN4/c7-3-1-9-6(8)5-4(3)10-2-11-5/h1-2H,(H2,8,9)(H,10,11) |
| InChIKey | JNVAYRKQQLXCQL-UHFFFAOYSA-N |
| Smiles | C1=C(C2=C(C(=N1)N)NC=N2)Cl |
| Isomeric SMILES | C1=C(C2=C(C(=N1)N)NC=N2)Cl |
| PubChem CID | 11788514 |
| Molecular Weight | 168.58 |
| Molecular Weight | 168.580 g/mol |
|---|---|
| XLogP3 | 0.700 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 168.02 Da |
| Monoisotopic Mass | 168.02 Da |
| Topological Polar Surface Area | 67.600 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 154.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |