Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M631510-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$194.90
|
|
|
M631510-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$310.90
|
|
|
M631510-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$549.90
|
|
|
M631510-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$989.90
|
|
| Synonyms | 6-methyl-2-azaspiro[3.3]heptane hydrochloride | 2089649-42-1 | 6-methyl-2-azaspiro[3.3]heptane hcl | 6-methyl-2-azaspiro[3.3]heptane | hydrochloride | MFCD30829398 | AKOS037643986 | PB41796 | AS-43776 | CS-0050166 | 6-methyl-2-azaspiro[3.3]heptanehydrochl |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature,Argon charged |
| Shipped In | Normal |
| IUPAC Name | 6-methyl-2-azaspiro[3.3]heptane;hydrochloride |
|---|---|
| INCHI | InChI=1S/C7H13N.ClH/c1-6-2-7(3-6)4-8-5-7;/h6,8H,2-5H2,1H3;1H |
| InChIKey | DLLVYOKIJGFCAY-UHFFFAOYSA-N |
| Smiles | CC1CC2(C1)CNC2.Cl |
| PubChem CID | 134129720 |
| Molecular Weight | 147.64 |
| Molecular Weight | 147.640 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 147.081 Da |
| Monoisotopic Mass | 147.081 Da |
| Topological Polar Surface Area | 12.000 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 97.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |