Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
F586666-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$109.90
|
|
| Synonyms | SCHEMBL20491295 | SY358403 | 1220039-98-4 | AKOS016008942 | 6-Fluoro-1,2,3,4-tetrahydronaphthalen-1-amine | 6-Fluoro-1,2,3,4-tetrahydro-naphthalen-1-ylamine | DTXSID20695755 | MFCD09256236 | SB31962 | 6-Fluoro-1,2,3,4-tetrahydronaphtylamine-1-amine | 6-Fl |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C,Protected from light,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Tetralins |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Tetralins |
| Alternative Parents | Aralkylamines Aryl fluorides Organopnictogen compounds Organofluorides Monoalkylamines Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Tetralin - Aralkylamine - Aryl halide - Aryl fluoride - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Organofluoride - Organohalogen compound - Primary aliphatic amine - Amine - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as tetralins. These are polycyclic aromatic compounds containing a tetralin moiety, which consists of a benzene fused to a cyclohexane. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 6-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| INCHI | InChI=1S/C10H12FN/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h4-6,10H,1-3,12H2 |
| InChIKey | WEVSXXAELLQXOQ-UHFFFAOYSA-N |
| Smiles | C1CC(C2=C(C1)C=C(C=C2)F)N |
| Isomeric SMILES | C1CC(C2=C(C1)C=C(C=C2)F)N |
| Molecular Weight | 165.2 |
| Reaxy-Rn | 33157805 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=33157805&ln= |
| Molecular Weight | 165.210 g/mol |
|---|---|
| XLogP3 | 1.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 165.095 Da |
| Monoisotopic Mass | 165.095 Da |
| Topological Polar Surface Area | 26.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 160.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |