Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D166263-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$605.90
|
|
| Synonyms | [6-(dimethoxymethyl)furo[3,2-b]pyridin-2-yl]-trimethylsilane | 6-(Dimethoxymethyl)-2-(trimethylsilyl)furo[3,2-b]pyridine, AldrichCPR | DTXSID00674104 | AKOS015851650 | MFCD12922801 | 1186310-76-8 | 6-(Dimethoxymethyl)-2-(trimethylsilyl)-furo[3,2-b]pyridin |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Furopyridines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Furopyridines |
| Alternative Parents | Alkylarylsilanes Pyridines and derivatives Heteroaromatic compounds Furans Oxacyclic compounds Organic metalloid salts Azacyclic compounds Acetals Organopnictogen compounds Organonitrogen compounds Hydrocarbon derivatives Alkylsilanes |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Furopyridine - Alkylarylsilane - Pyridine - Furan - Heteroaromatic compound - Acetal - Oxacycle - Azacycle - Organic metalloid salt - Organic nitrogen compound - Organosilicon compound - Hydrocarbon derivative - Alkylsilane - Organopnictogen compound - Organooxygen compound - Organonitrogen compound - Organic metalloid moeity - Organic oxygen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as furopyridines. These are aromatic heterocyclic compounds containing a furopyridine ring system, which consists of a furan ring fused to a pyridine ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | [6-(dimethoxymethyl)furo[3,2-b]pyridin-2-yl]-trimethylsilane |
|---|---|
| INCHI | InChI=1S/C13H19NO3Si/c1-15-13(16-2)9-6-11-10(14-8-9)7-12(17-11)18(3,4)5/h6-8,13H,1-5H3 |
| InChIKey | MWFIDQQTGAIZEU-UHFFFAOYSA-N |
| Smiles | COC(C1=CC2=C(C=C(O2)[Si](C)(C)C)N=C1)OC |
| Isomeric SMILES | COC(C1=CC2=C(C=C(O2)[Si](C)(C)C)N=C1)OC |
| WGK Germany | 3 |
| PubChem CID | 46737941 |
| Molecular Weight | 265.38 |
| Molecular Weight | 265.380 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 265.113 Da |
| Monoisotopic Mass | 265.113 Da |
| Topological Polar Surface Area | 44.500 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 278.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |