Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D165428-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$605.90
|
|
| Synonyms | DTXSID70640154 | 1015609-43-4 | D75019 | 6-(Dimethoxymethyl)-1H-pyrrolo[3,2-b]pyridine, AldrichCPR | FT-0740385 | MFCD09859115 | 1h-pyrrolo[3,2-b]pyridine,6-(dimethoxymethyl)- | 4-Hydroxy-6-iodoquinoline-3-carboxylicacid | 6-(Dimethoxymethyl)-1H-pyrrolo[3 |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrrolopyridines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrrolopyridines |
| Alternative Parents | Pyridines and derivatives Pyrroles Heteroaromatic compounds Azacyclic compounds Acetals Organopnictogen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyrrolopyridine - Pyridine - Heteroaromatic compound - Pyrrole - Azacycle - Acetal - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrrolopyridines. These are compounds containing a pyrrolopyridine moiety, which consists of a pyrrole ring fused to a pyridine. Pyrrole is 5-membered ring consisting of four carbon atoms and one nitrogen atom. Pyridine is a 6-membered ring consisting of five carbon atoms and one nitrogen center. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 6-(dimethoxymethyl)-1H-pyrrolo[3,2-b]pyridine |
|---|---|
| INCHI | InChI=1S/C10H12N2O2/c1-13-10(14-2)7-5-9-8(12-6-7)3-4-11-9/h3-6,10-11H,1-2H3 |
| InChIKey | CMPMAKMKOVYMKM-UHFFFAOYSA-N |
| Smiles | COC(C1=CC2=C(C=CN2)N=C1)OC |
| Isomeric SMILES | COC(C1=CC2=C(C=CN2)N=C1)OC |
| WGK Germany | 3 |
| PubChem CID | 24229265 |
| Molecular Weight | 192.21 |
| Molecular Weight | 192.210 g/mol |
|---|---|
| XLogP3 | 0.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 192.09 Da |
| Monoisotopic Mass | 192.09 Da |
| Topological Polar Surface Area | 47.100 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 185.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |