Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D191371-50mg
|
50mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$702.90
|
|
Discover 6-(Difluoromethyl)pyridin-3-amine hydrochloride by Aladdin Scientific in 95% for only $702.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 6-(Difluoromethyl)pyridin-3-amine hydrochloride | 1646152-50-2 | 6-(difluoromethyl)pyridin-3-amine;hydrochloride | 3-Pyridinamine, 6-(difluoromethyl)-, hydrochloride (1:1) | 6-(DIFLUOROMETHYL)PYRIDIN-3-AMINE HCL | WQC15250 | MFCD27920770 | AKOS022185748 | SB85762 | AS-7015 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Aminopyridines and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aminopyridines and derivatives |
| Alternative Parents | Heteroaromatic compounds Azacyclic compounds Primary amines Organofluorides Hydrochlorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aminopyridine - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Hydrochloride - Primary amine - Organonitrogen compound - Organofluoride - Organohalogen compound - Amine - Alkyl halide - Alkyl fluoride - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aminopyridines and derivatives. These are organic heterocyclic compounds containing an amino group attached to a pyridine ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 6-(difluoromethyl)pyridin-3-amine;hydrochloride |
|---|---|
| INCHI | InChI=1S/C6H6F2N2.ClH/c7-6(8)5-2-1-4(9)3-10-5;/h1-3,6H,9H2;1H |
| InChIKey | HNAHLGAGIBHCRG-UHFFFAOYSA-N |
| Smiles | C1=CC(=NC=C1N)C(F)F.Cl |
| Isomeric SMILES | C1=CC(=NC=C1N)C(F)F.Cl |
| PubChem CID | 73554328 |
| Molecular Weight | 180.58 |
| Molecular Weight | 180.580 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 180.027 Da |
| Monoisotopic Mass | 180.027 Da |
| Topological Polar Surface Area | 38.900 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 108.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |