Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C169827-25mg
|
25mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$410.90
|
|
| Synonyms | 6-(chloromethyl)-2-isopropylpyrimidin-4-ol | 35252-94-9 | 4-(chloromethyl)-2-propan-2-yl-1H-pyrimidin-6-one | SCHEMBL7253219 | SCHEMBL10716203 | ZKCAVUYFKJKMRI-UHFFFAOYSA-N | MFCD00023251 | AKOS009158588 | AKOS015994149 | MS-1918 | SB56923 | 2-isopropyl-4-hydroxy-6-chloromethy |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrimidines and pyrimidine derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrimidones |
| Alternative Parents | Hydropyrimidines Vinylogous amides Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organochlorides Organic oxides Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyrimidone - Hydropyrimidine - Vinylogous amide - Heteroaromatic compound - Azacycle - Alkyl chloride - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organic nitrogen compound - Alkyl halide - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrimidones. These are compounds that contain a pyrimidine ring, which bears a ketone. Pyrimidine is a 6-membered ring consisting of four carbon atoms and two nitrogen centers at the 1- and 3- ring positions. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-(chloromethyl)-2-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| INCHI | InChI=1S/C8H11ClN2O/c1-5(2)8-10-6(4-9)3-7(12)11-8/h3,5H,4H2,1-2H3,(H,10,11,12) |
| InChIKey | ZKCAVUYFKJKMRI-UHFFFAOYSA-N |
| Smiles | CC(C)C1=NC(=CC(=O)N1)CCl |
| Isomeric SMILES | CC(C)C1=NC(=CC(=O)N1)CCl |
| PubChem CID | 135410098 |
| Molecular Weight | 186.643 |
| Molecular Weight | 186.640 g/mol |
|---|---|
| XLogP3 | 0.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 186.056 Da |
| Monoisotopic Mass | 186.056 Da |
| Topological Polar Surface Area | 41.500 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 256.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |