Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B469778-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$241.90
|
|
| Synonyms | SCHEMBL18207426 | DTXSID00584734 | 3-(6-Bromo-4-oxo-4H-1-benzopyran-3-yl)propanoic acid | 3-(6-bromo-4-oxochromen-3-yl)propanoic acid | 3-(6-Bromo-4-oxo-4H-chromen-3-yl)propanoic acid | AKOS002674431 | 6-Bromochromone-3-propionic acid, 97% | F70949 | MFCD |
|---|---|
| Specifications & Purity | ≥97% |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Benzopyrans |
| Subclass | 1-benzopyrans |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Chromones |
| Alternative Parents | Pyranones and derivatives Benzenoids Aryl bromides Heteroaromatic compounds Oxacyclic compounds Monocarboxylic acids and derivatives Carboxylic acids Organobromides Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Chromone - Pyranone - Aryl bromide - Aryl halide - Benzenoid - Pyran - Heteroaromatic compound - Carboxylic acid derivative - Carboxylic acid - Monocarboxylic acid or derivatives - Oxacycle - Organic oxide - Hydrocarbon derivative - Organic oxygen compound - Organohalogen compound - Organobromide - Organooxygen compound - Carbonyl group - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as chromones. These are compounds containing a benzopyran-4-one moiety. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3-(6-bromo-4-oxochromen-3-yl)propanoic acid |
|---|---|
| INCHI | InChI=1S/C12H9BrO4/c13-8-2-3-10-9(5-8)12(16)7(6-17-10)1-4-11(14)15/h2-3,5-6H,1,4H2,(H,14,15) |
| InChIKey | ZMALAWNLBXZMLK-UHFFFAOYSA-N |
| Smiles | C1=CC2=C(C=C1Br)C(=O)C(=CO2)CCC(=O)O |
| Isomeric SMILES | C1=CC2=C(C=C1Br)C(=O)C(=CO2)CCC(=O)O |
| WGK Germany | 3 |
| Molecular Weight | 297.1 |
| Reaxy-Rn | 11143762 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=11143762&ln= |
| Molecular Weight | 297.100 g/mol |
|---|---|
| XLogP3 | 2.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 295.968 Da |
| Monoisotopic Mass | 295.968 Da |
| Topological Polar Surface Area | 63.600 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 364.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |