Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B180808-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,426.90
|
|
Discover 6-Bromo-7-methoxyfuro[3,2-c]pyridine by Aladdin Scientific in 95% for only $1,426.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 6-Bromo-7-methoxyfuro[3,2-c]pyridine | 1261366-01-1 | DTXSID201280411 | MFCD18374152 | AKOS015835134 | Furo[3,2-c]pyridine, 6-bromo-7-methoxy- | CS-0443716 | 6-Bromo-7-methoxyfuro[3,2-c]pyridine, AldrichCPR |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Furopyridines |
| Subclass | Furo[3,2-c]pyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Furo[3,2-c]pyridines |
| Alternative Parents | Alkyl aryl ethers 2-halopyridines Aryl bromides Heteroaromatic compounds Furans Oxacyclic compounds Azacyclic compounds Organonitrogen compounds Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Furo[3,2-c]pyridine - Alkyl aryl ether - 2-halopyridine - Aryl bromide - Aryl halide - Pyridine - Heteroaromatic compound - Furan - Ether - Oxacycle - Azacycle - Organobromide - Organohalogen compound - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Organooxygen compound - Organic oxygen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as furo[3,2-c]pyridines. These are aromatic compounds containing a furopyridine ring system, where the O- and the N-atom are at the 1- and 5- position, respectively. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 6-bromo-7-methoxyfuro[3,2-c]pyridine |
|---|---|
| INCHI | InChI=1S/C8H6BrNO2/c1-11-7-6-5(2-3-12-6)4-10-8(7)9/h2-4H,1H3 |
| InChIKey | HPTHINRGEKOOFF-UHFFFAOYSA-N |
| Smiles | COC1=C2C(=CN=C1Br)C=CO2 |
| Isomeric SMILES | COC1=C2C(=CN=C1Br)C=CO2 |
| Molecular Weight | 228 |
| Reaxy-Rn | 60079230 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=60079230&ln= |
| Molecular Weight | 228.040 g/mol |
|---|---|
| XLogP3 | 2.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 226.958 Da |
| Monoisotopic Mass | 226.958 Da |
| Topological Polar Surface Area | 35.300 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 167.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |