Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B179942-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,741.90
|
|
Discover 6-Bromo-2-methoxy-4-methylquinoline by Aladdin Scientific in 98% for only $2,741.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 6-BROMO-2-METHOXY-4-METHYLQUINOLINE | 1187386-12-4 | SCHEMBL1224169 | DTXSID10674993 | MFCD12756430 | AKOS015834564 | SB69002 | BS-23422 | CS-0211907 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinolines and derivatives |
| Subclass | Quinolones and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Quinolones and derivatives |
| Alternative Parents | Haloquinolines Methylpyridines Alkyl aryl ethers Benzenoids Aryl bromides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Haloquinoline - Quinolone - Alkyl aryl ether - Methylpyridine - Aryl bromide - Aryl halide - Pyridine - Benzenoid - Heteroaromatic compound - Ether - Azacycle - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organobromide - Organohalogen compound - Hydrocarbon derivative - Organic oxygen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as quinolones and derivatives. These are compounds containing a quinoline moiety which bears a ketone group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 6-bromo-2-methoxy-4-methylquinoline |
|---|---|
| INCHI | InChI=1S/C11H10BrNO/c1-7-5-11(14-2)13-10-4-3-8(12)6-9(7)10/h3-6H,1-2H3 |
| InChIKey | RWIMTGNHIFFBGY-UHFFFAOYSA-N |
| Smiles | CC1=CC(=NC2=C1C=C(C=C2)Br)OC |
| Isomeric SMILES | CC1=CC(=NC2=C1C=C(C=C2)Br)OC |
| Molecular Weight | 252.1 |
| Reaxy-Rn | 20887329 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=20887329&ln= |
| Molecular Weight | 252.110 g/mol |
|---|---|
| XLogP3 | 3.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 250.995 Da |
| Monoisotopic Mass | 250.995 Da |
| Topological Polar Surface Area | 22.100 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 200.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |