Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B173657-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,919.90
|
|
Discover 6-bromo-1H-pyrazolo[4,3-b]pyridine-3-carboxylic acid by Aladdin Scientific in 97% for only $2,919.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 6-BROMO-1H-PYRAZOLO[4,3-B]PYRIDINE-3-CARBOXYLIC ACID | 1363382-29-9 | 1H-Pyrazolo[4,3-b]pyridine-3-carboxylic acid, 6-bromo- | DTXSID201208093 | AKOS024167658 | PB37203 | SB19856 | AS-51561 | CS-0050312 | P12950 | 6-BROMO-1H-PYRAZOLO[4,3-B]PYRIDINE-3-CARBOXYLICACID |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrazolopyridines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrazolopyridines |
| Alternative Parents | Pyrazole carboxylic acids and derivatives Pyridines and derivatives Aryl bromides Heteroaromatic compounds Carboxylic acids Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organobromides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyrazolopyridine - Pyrazole-5-carboxylic acid or derivatives - Pyrazole-3-carboxylic acid or derivatives - Aryl bromide - Aryl halide - Pyridine - Azole - Heteroaromatic compound - Pyrazole - Carboxylic acid derivative - Carboxylic acid - Azacycle - Organonitrogen compound - Organobromide - Organohalogen compound - Organic nitrogen compound - Organic oxide - Organooxygen compound - Hydrocarbon derivative - Organic oxygen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrazolopyridines. These are compounds containing a pyrazolopyridine skeleton, which consists of a pyrazole fused to a pyridine. Pyrazole is 5-membered ring consisting of three carbon atoms and two adjacent nitrogen centers. Pyridine is a 6-membered ring with four carbon and one nitrogen atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 6-bromo-1H-pyrazolo[4,3-b]pyridine-3-carboxylic acid |
|---|---|
| INCHI | InChI=1S/C7H4BrN3O2/c8-3-1-4-5(9-2-3)6(7(12)13)11-10-4/h1-2H,(H,10,11)(H,12,13) |
| InChIKey | IZKLWDBZQAFKJY-UHFFFAOYSA-N |
| Smiles | C1=C(C=NC2=C1NN=C2C(=O)O)Br |
| Isomeric SMILES | C1=C(C=NC2=C1NN=C2C(=O)O)Br |
| PubChem CID | 72207954 |
| Molecular Weight | 242.032 |
| Molecular Weight | 242.030 g/mol |
|---|---|
| XLogP3 | 1.100 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 240.949 Da |
| Monoisotopic Mass | 240.949 Da |
| Topological Polar Surface Area | 78.900 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 226.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |