Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T478561-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,773.90
|
|
| Synonyms | 5-Trifluoromethyl-3-((trimethylsilyl)ethynyl)pyridin-2-amine | AKOS015852646 | 5-(Trifluoromethyl)-3-[(trimethylsilyl)ethynyl]pyridin-2-amine | 1036027-52-7 | DTXSID40673934 | MFCD12026753 | 5-(TRIFLUOROMETHYL)-3-((TRIMETHYLSILYL)ETHYNYL)-PYRIDIN-2-AMINE |
|---|---|
| Specifications & Purity | Reagent grade |
| Legal Information | Product of Adesis |
| Grade | Reagent Grade |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Aminopyridines and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aminopyridines and derivatives |
| Alternative Parents | Imidolactams Heteroaromatic compounds Trialkylsilanes Organic metalloid salts Azacyclic compounds Primary amines Organofluorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aminopyridine - Imidolactam - Heteroaromatic compound - Trialkylsilane - Azacycle - Organic metalloid salt - Alkyl fluoride - Hydrocarbon derivative - Organosilicon compound - Alkylsilane - Primary amine - Organonitrogen compound - Organofluoride - Organic metalloid moeity - Organohalogen compound - Organic nitrogen compound - Amine - Alkyl halide - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aminopyridines and derivatives. These are organic heterocyclic compounds containing an amino group attached to a pyridine ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5-(trifluoromethyl)-3-(2-trimethylsilylethynyl)pyridin-2-amine |
|---|---|
| INCHI | InChI=1S/C11H13F3N2Si/c1-17(2,3)5-4-8-6-9(11(12,13)14)7-16-10(8)15/h6-7H,1-3H3,(H2,15,16) |
| InChIKey | KLSNMJYIWORYMD-UHFFFAOYSA-N |
| Smiles | C[Si](C)(C)C#CC1=C(N=CC(=C1)C(F)(F)F)N |
| Isomeric SMILES | C[Si](C)(C)C#CC1=C(N=CC(=C1)C(F)(F)F)N |
| PubChem CID | 46736871 |
| Molecular Weight | 258.32 |
| Molecular Weight | 258.310 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 2 |
| Exact Mass | 258.08 Da |
| Monoisotopic Mass | 258.08 Da |
| Topological Polar Surface Area | 38.900 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 334.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |