Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T194219-25mg
|
25mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$818.90
|
|
Discover 5-(Trifluoromethyl)-1H-imidazo[4,5-b]pyridine by Aladdin Scientific in 97% for only $818.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 5-(Trifluoromethyl)-1H-imidazo[4,5-b]pyridine | 617678-32-7 | 5-(TRIFLUOROMETHYL)-3H-IMIDAZO[4,5-B]PYRIDINE | MFCD13193496 | SCHEMBL7134092 | SCHEMBL18663635 | DTXSID60741609 | JLWCYGRWTPNODY-UHFFFAOYSA-N | AKOS022175894 | AB73272 | DS-11841 | SY120047 | C75899 | EN300-7413650 | A86 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Imidazopyridines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Imidazopyridines |
| Alternative Parents | Pyridines and derivatives Imidazoles Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organofluorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Imidazopyridine - Pyridine - Heteroaromatic compound - Imidazole - Azole - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Organofluoride - Organohalogen compound - Alkyl halide - Alkyl fluoride - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as imidazopyridines. These are organic polycyclic compounds containing an imidazole ring fused to a pyridine ring. Imidazole is 5-membered ring consisting of three carbon atoms, and two nitrogen centers at the 1- and 3-positions. Pyridine is a 6-membered ring consisting of five carbon atoms and one nitrogen center. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5-(trifluoromethyl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| INCHI | InChI=1S/C7H4F3N3/c8-7(9,10)5-2-1-4-6(13-5)12-3-11-4/h1-3H,(H,11,12,13) |
| InChIKey | JLWCYGRWTPNODY-UHFFFAOYSA-N |
| Smiles | C1=CC(=NC2=C1NC=N2)C(F)(F)F |
| Isomeric SMILES | C1=CC(=NC2=C1NC=N2)C(F)(F)F |
| PubChem CID | 70000032 |
| Molecular Weight | 187.12 |
| Molecular Weight | 187.120 g/mol |
|---|---|
| XLogP3 | 1.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 0 |
| Exact Mass | 187.036 Da |
| Monoisotopic Mass | 187.036 Da |
| Topological Polar Surface Area | 41.600 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 194.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |