Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M586651-250mg
|
250mg |
3
|
$101.90
|
|
|
M586651-1g
|
1g |
2
|
$364.90
|
|
| Synonyms | 1217500-64-5 | D92871 | 5-(METHOXYCARBONYL)-1H-PYRROL-2-YLBORONIC ACID | (5-(Methoxycarbonyl)-1H-pyrrol-2-yl)boronic acid | BCP17117 | (5-methoxycarbonyl-1H-pyrrol-2-yl)boronic acid | 5-(METHOXYCARBONYL)PYRROLE-2-BORONIC ACID | DTXSID90681544 | (5-(Methox |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Store at -20°C,Argon charged |
| Shipped In |
Ice chest + Ice pads This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrroles |
| Subclass | Pyrrole carboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrrole carboxylic acids and derivatives |
| Alternative Parents | Substituted pyrroles Methyl esters Heteroaromatic compounds Boronic acids Organic metalloid salts Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organometalloid compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyrrole-2-carboxylic acid or derivatives - Substituted pyrrole - Methyl ester - Heteroaromatic compound - Boronic acid derivative - Carboxylic acid ester - Boronic acid - Azacycle - Organic metalloid salt - Carboxylic acid derivative - Hydrocarbon derivative - Organic oxygen compound - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organic metalloid moeity - Organic oxide - Organopnictogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrrole carboxylic acids and derivatives. These are heterocyclic compounds containing a pyrrole ring bearing a carboxyl group (or a derivative thereof). |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (5-methoxycarbonyl-1H-pyrrol-2-yl)boronic acid |
|---|---|
| INCHI | InChI=1S/C6H8BNO4/c1-12-6(9)4-2-3-5(8-4)7(10)11/h2-3,8,10-11H,1H3 |
| InChIKey | OERJCWGVVLKNIL-UHFFFAOYSA-N |
| Smiles | B(C1=CC=C(N1)C(=O)OC)(O)O |
| Isomeric SMILES | B(C1=CC=C(N1)C(=O)OC)(O)O |
| Molecular Weight | 168.94 |
| Reaxy-Rn | 39118318 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=39118318&ln= |
| Molecular Weight | 168.950 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 169.055 Da |
| Monoisotopic Mass | 169.055 Da |
| Topological Polar Surface Area | 82.600 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 175.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |