Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M635428-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$486.90
|
|
| Synonyms | MFCD06659754 | PS-16271 | SCHEMBL8388284 | P20217 | 1060803-15-7 | 2,3-Dihydro-5-methoxy-1H-pyrrolo[2,3-b]pyridine | SY321746 | DTXSID001244851 | AB26242 | AKOS006293867 | 5-METHOXY-2,3-DIHYDRO-1H-PYRROLO[2,3-B]PYRIDINE | 5-Methoxy-2,3-dihydro-7-azaindole |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrrolopyridines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrrolopyridines |
| Alternative Parents | Secondary alkylarylamines Alkyl aryl ethers Pyridines and derivatives Imidolactams Heteroaromatic compounds Azacyclic compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyrrolopyridine - Alkyl aryl ether - Secondary aliphatic/aromatic amine - Pyridine - Imidolactam - Heteroaromatic compound - Secondary amine - Ether - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Amine - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrrolopyridines. These are compounds containing a pyrrolopyridine moiety, which consists of a pyrrole ring fused to a pyridine. Pyrrole is 5-membered ring consisting of four carbon atoms and one nitrogen atom. Pyridine is a 6-membered ring consisting of five carbon atoms and one nitrogen center. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| INCHI | InChI=1S/C8H10N2O/c1-11-7-4-6-2-3-9-8(6)10-5-7/h4-5H,2-3H2,1H3,(H,9,10) |
| InChIKey | PGLJXNZHDZDAPQ-UHFFFAOYSA-N |
| Smiles | COC1=CC2=C(NCC2)N=C1 |
| Isomeric SMILES | COC1=CC2=C(NCC2)N=C1 |
| Alternate CAS | 1060803-15-7 |
| PubChem CID | 55255548 |
| Molecular Weight | 150.18 |
| Molecular Weight | 150.180 g/mol |
|---|---|
| XLogP3 | 1.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 150.079 Da |
| Monoisotopic Mass | 150.079 Da |
| Topological Polar Surface Area | 34.200 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 140.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |