Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M476813-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$851.90
|
|
| Synonyms | 2-(6-methoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)acetic acid | MFCD00003787 | Oprea1_266175 | 2-(6-methoxy-3-oxo-1,2-dihydroinden-1-yl)acetic acid | 6-Methoxy-3-oxo-2,3-dihydro-1H-indene-1-acetic acid | 5-Methoxy-1-indanone-3-acetic acid | J-015541 | STL52574 |
|---|---|
| Specifications & Purity | technical grade |
| Grade | technical grade |
| Product Description |
Description The 5-methoxy-1-indanone-3-acetic acid derivatives are potent inhibitors of chymotrypsin-like activity of the 20S proteasome. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Indanes |
| Subclass | Indanones |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Indanones |
| Alternative Parents | Aryl alkyl ketones Anisoles Alkyl aryl ethers Monocarboxylic acids and derivatives Carboxylic acids Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Indanone - Aryl alkyl ketone - Aryl ketone - Anisole - Alkyl aryl ether - Ketone - Monocarboxylic acid or derivatives - Ether - Carboxylic acid - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as indanones. These are compounds containing an indane ring bearing a ketone group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-(6-methoxy-3-oxo-1,2-dihydroinden-1-yl)acetic acid |
|---|---|
| INCHI | InChI=1S/C12H12O4/c1-16-8-2-3-9-10(6-8)7(4-11(9)13)5-12(14)15/h2-3,6-7H,4-5H2,1H3,(H,14,15) |
| InChIKey | QOTZOFGBBCMWEP-UHFFFAOYSA-N |
| Smiles | COC1=CC2=C(C=C1)C(=O)CC2CC(=O)O |
| Isomeric SMILES | COC1=CC2=C(C=C1)C(=O)CC2CC(=O)O |
| Molecular Weight | 220.23 |
| Reaxy-Rn | 2118149 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2118149&ln= |
| Solubility | chloroform: soluble 5%, clear, yellow-brown |
|---|---|
| Molecular Weight | 220.220 g/mol |
| XLogP3 | 0.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 220.074 Da |
| Monoisotopic Mass | 220.074 Da |
| Topological Polar Surface Area | 63.600 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 299.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |