Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
I479740-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$689.90
|
|
| Synonyms | DTXSID00650867 | AKOS010758713 | (5-Isopropyl-1,2,4-oxadiazol-3-yl)methanol, AldrichCPR | [5-(Propan-2-yl)-1,2,4-oxadiazol-3-yl]methanol | FT-0757583 | CHEMBRDG-BB 4013198 | SCHEMBL9918171 | MFCD08059903 | (5-propan-2-yl-1,2,4-oxadiazol-3-yl)methanol | BS |
|---|---|
| Specifications & Purity | Reagent grade |
| Legal Information | Product of ChemBridge Corp. |
| Grade | Reagent Grade |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azoles |
| Subclass | Oxadiazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 1,2,4-oxadiazoles |
| Alternative Parents | Heteroaromatic compounds Oxacyclic compounds Azacyclic compounds Primary alcohols Organonitrogen compounds Hydrocarbon derivatives Aromatic alcohols |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Heteroaromatic compound - 1,2,4-oxadiazole - Oxacycle - Azacycle - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Aromatic alcohol - Primary alcohol - Organooxygen compound - Organonitrogen compound - Alcohol - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 1,2,4-oxadiazoles. These are compounds containing an oxadiazole ring with the oxygen and the two nitrogen atoms at positions 1, 2, and 4, respectively. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (5-propan-2-yl-1,2,4-oxadiazol-3-yl)methanol |
|---|---|
| INCHI | InChI=1S/C6H10N2O2/c1-4(2)6-7-5(3-9)8-10-6/h4,9H,3H2,1-2H3 |
| InChIKey | VGQFCAAVDHZPFI-UHFFFAOYSA-N |
| Smiles | CC(C)C1=NC(=NO1)CO |
| Isomeric SMILES | CC(C)C1=NC(=NO1)CO |
| WGK Germany | 3 |
| Molecular Weight | 142.16 |
| Reaxy-Rn | 30364709 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=30364709&ln= |
| Molecular Weight | 142.160 g/mol |
|---|---|
| XLogP3 | 0.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 142.074 Da |
| Monoisotopic Mass | 142.074 Da |
| Topological Polar Surface Area | 59.200 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 108.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |