Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
I113818-1g
|
1g |
3
|
$26.90
|
|
|
I113818-5g
|
5g |
2
|
$102.90
|
|
|
I113818-10g
|
10g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$184.90
|
|
|
I113818-25g
|
25g |
1
|
$361.90
|
|
|
I113818-100g
|
100g |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$1,299.90
|
|
| Synonyms | 3-Iodo-6-methylaniline | 5-Iodo-2-methylaniline, 97% | I1021 | AC-3744 | DS-0913 | FT-0620518 | ZFH45ZPW2Q | A840672 | EINECS 281-094-2 | STL554373 | AM20050550 | 2-Amino-4-iodotoluene | 5-Iodo-2-methyl-phenylamine | 5-Iodo-2-methylaniline # | EN300-88614 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Argon charged |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Toluenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aminotoluenes |
| Alternative Parents | Aniline and substituted anilines Iodobenzenes Aryl iodides Primary amines Organopnictogen compounds Organoiodides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Aminotoluene - Aniline or substituted anilines - Iodobenzene - Halobenzene - Aryl iodide - Aryl halide - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Organoiodide - Organohalogen compound - Amine - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aminotoluenes. These are organic aromatic compounds containing a benzene that carries a single methyl group and one amino group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504759129 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504759129 |
| IUPAC Name | 5-iodo-2-methylaniline |
| INCHI | InChI=1S/C7H8IN/c1-5-2-3-6(8)4-7(5)9/h2-4H,9H2,1H3 |
| InChIKey | IOEHXNCBPIBDBZ-UHFFFAOYSA-N |
| Smiles | CC1=C(C=C(C=C1)I)N |
| Isomeric SMILES | CC1=C(C=C(C=C1)I)N |
| WGK Germany | 3 |
| UN Number | 2811 |
| Molecular Weight | 233.05 |
| Reaxy-Rn | 2078769 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2078769&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jun 06, 2023 | I113818 | |
| Certificate of Analysis | Apr 27, 2023 | I113818 | |
| Certificate of Analysis | Mar 10, 2023 | I113818 | |
| Certificate of Analysis | Jan 05, 2023 | I113818 |
| Solubility | Soluble in Methanol |
|---|---|
| Sensitivity | Light & air sensitive. |
| Flash Point(°F) | >230 °F |
| Flash Point(°C) | 110 °C |
| Boil Point(°C) | 273°C |
| Melt Point(°C) | 48-52°C |
| Molecular Weight | 233.050 g/mol |
| XLogP3 | 2.100 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 232.97 Da |
| Monoisotopic Mass | 232.97 Da |
| Topological Polar Surface Area | 26.000 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 94.900 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |