Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E187577-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,132.90
|
|
| Synonyms | 88040-88-4 | 5-ethyl-2-methoxybenzene-1-sulfonyl chloride | 5-ethyl-2-methoxy-benzenesulfonyl Chloride | 5-ethyl-2-methoxybenzenesulfonyl chloride | MFCD03424997 | SCHEMBL741235 | DTXSID00374531 | AB1434 | AKOS005139309 | 5-Ethyl-2-methoxybenzenesulfonylchloride | 5-ethyl-2- |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzenesulfonyl compounds |
| Intermediate Tree Nodes | Benzenesulfonyl halides |
| Direct Parent | Benzenesulfonyl chlorides |
| Alternative Parents | Phenoxy compounds Methoxybenzenes Anisoles Alkyl aryl ethers Sulfonyls Sulfonyl chlorides Organosulfonic acids and derivatives Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzenesulfonyl chloride - Phenoxy compound - Anisole - Methoxybenzene - Phenol ether - Alkyl aryl ether - Sulfonyl - Sulfonyl halide - Sulfonyl chloride - Organosulfonic acid or derivatives - Organic sulfonic acid or derivatives - Ether - Organic oxygen compound - Organosulfur compound - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzenesulfonyl chlorides. These are aromatic compounds containing a benzenesulfonyl group, where the sulfonyl moiety is singly boned to a chloride atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5-ethyl-2-methoxybenzenesulfonyl chloride |
|---|---|
| INCHI | InChI=1S/C9H11ClO3S/c1-3-7-4-5-8(13-2)9(6-7)14(10,11)12/h4-6H,3H2,1-2H3 |
| InChIKey | VHCODCZMAYFSHT-UHFFFAOYSA-N |
| Smiles | CCC1=CC(=C(C=C1)OC)S(=O)(=O)Cl |
| Isomeric SMILES | CCC1=CC(=C(C=C1)OC)S(=O)(=O)Cl |
| Molecular Weight | 234.7 |
| Reaxy-Rn | 2646462 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2646462&ln= |
| Molecular Weight | 234.700 g/mol |
|---|---|
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 234.012 Da |
| Monoisotopic Mass | 234.012 Da |
| Topological Polar Surface Area | 51.800 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 270.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |