Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B165856-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$605.90
|
|
Discover 5-Bromo-3-methoxy-2-(trimethylsilyl)pyridine by Aladdin Scientific in for only $605.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | DTXSID00670141 | (5-bromo-3-methoxypyridin-2-yl)-trimethylsilane | MFCD11857634 | 1087659-25-3 | 5-Bromo-3-methoxy-2-(trimethylsilyl)pyridine, AldrichCPR | 5-Bromo-3-methoxy-2-(trimethylsilyl)pyridine | AKOS015834412 |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Ethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkyl aryl ethers |
| Alternative Parents | Alkylarylsilanes Pyridines and derivatives Aryl bromides Heteroaromatic compounds Organic metalloid salts Azacyclic compounds Organonitrogen compounds Organobromides Hydrocarbon derivatives Alkylsilanes |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Alkyl aryl ether - Alkylarylsilane - Aryl bromide - Aryl halide - Pyridine - Heteroaromatic compound - Azacycle - Organic metalloid salt - Organoheterocyclic compound - Organic nitrogen compound - Alkylsilane - Organonitrogen compound - Organobromide - Organic metalloid moeity - Organohalogen compound - Organosilicon compound - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkyl aryl ethers. These are organic compounds containing the alkyl aryl ether functional group with the generic formula R-O-R' , where R is an alkyl group and R' is an aryl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (5-bromo-3-methoxypyridin-2-yl)-trimethylsilane |
|---|---|
| INCHI | InChI=1S/C9H14BrNOSi/c1-12-8-5-7(10)6-11-9(8)13(2,3)4/h5-6H,1-4H3 |
| InChIKey | VIXHZRDZEGWBCX-UHFFFAOYSA-N |
| Smiles | COC1=C(N=CC(=C1)Br)[Si](C)(C)C |
| Isomeric SMILES | COC1=C(N=CC(=C1)Br)[Si](C)(C)C |
| WGK Germany | 3 |
| PubChem CID | 45361760 |
| Molecular Weight | 260.2 |
| Molecular Weight | 260.200 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 259.003 Da |
| Monoisotopic Mass | 259.003 Da |
| Topological Polar Surface Area | 22.100 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 171.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |