Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B300702-5mg
|
5mg |
2
|
$59.90
|
|
|
B300702-25mg
|
25mg |
2
|
$193.90
|
|
| Synonyms | 30062-44-3 | 5-Allylsulfanyl-[1,3,4]thiadiazol-2-ylamine | 5-(Allylthio)-1,3,4-thiadiazol-2-amine | 5-(prop-2-en-1-ylsulfanyl)-1,3,4-thiadiazol-2-amine | 5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-amine | 5-[(Prop-2-en-1-yl)sulfanyl]-1,3,4-thiadiazol-2-amine | NSC52397 |
|---|---|
| Specifications & Purity | ≥95% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organosulfur compounds |
| Class | Thioethers |
| Subclass | Aryl thioethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aryl thioethers |
| Alternative Parents | Alkylarylthioethers 2-amino-5-substituted-1,3,4-thiadiazoles Heteroaromatic compounds Allyl sulfur compounds Sulfenyl compounds Azacyclic compounds Primary amines Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aryl thioether - 2-amino-5-substituted-1,3,4-thiadiazole - Alkylarylthioether - 2-amino-1,3,4-thiadiazole - Azole - Thiadiazole - Heteroaromatic compound - Allyl sulfur compound - Azacycle - Organoheterocyclic compound - Sulfenyl compound - Amine - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Organopnictogen compound - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aryl thioethers. These are organosulfur compounds containing a thioether group that is substituted by an aryl group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504758566 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504758566 |
| IUPAC Name | 5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-amine |
| INCHI | InChI=1S/C5H7N3S2/c1-2-3-9-5-8-7-4(6)10-5/h2H,1,3H2,(H2,6,7) |
| InChIKey | KKGCJNIVVSSVRG-UHFFFAOYSA-N |
| Smiles | C=CCSC1=NN=C(S1)N |
| Isomeric SMILES | C=CCSC1=NN=C(S1)N |
| Molecular Weight | 173.25 |
| Reaxy-Rn | 1073469 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1073469&ln= |
| Flash Point(°C) | 144.974°C |
|---|---|
| Boil Point(°C) | 316.102°Cat760mmHg |
| Molecular Weight | 173.300 g/mol |
| XLogP3 | 1.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Exact Mass | 173.008 Da |
| Monoisotopic Mass | 173.008 Da |
| Topological Polar Surface Area | 105.000 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 119.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |