Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D171590-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$72.90
|
|
Discover 5,8-dioxaspiro[3.4]octane-2-carboxylic acid by Aladdin Scientific in 97% for only $72.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 5,8-dioxaspiro[3.4]octane-2-carboxylic acid | 1001907-64-7 | 5,8-Dioxa-spiro[3.4]octane-2-carboxylic acid | 3-(1,3-Dioxolane)cyclobutanecarboxylic acid | MFCD11036133 | SCHEMBL12367831 | DTXSID90669726 | AMY35003 | BQB90764 | AKOS006307011 | PB31516 | AS-34150 | SY099102 | 5,8-dio |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Ethers |
| Intermediate Tree Nodes | Acetals |
| Direct Parent | Ketals |
| Alternative Parents | 1,3-dioxolanes Oxacyclic compounds Monocarboxylic acids and derivatives Carboxylic acids Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Ketal - Meta-dioxolane - Oxacycle - Organoheterocyclic compound - Monocarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Organic oxide - Hydrocarbon derivative - Carbonyl group - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as ketals. These are acetals derived from ketones by replacement of the oxo group by two hydrocarbyloxy groups R2C(OR)2 ( R not Hydrogen ). This term, once abandoned, has been reinstated as a subclass of acetals. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5,8-dioxaspiro[3.4]octane-2-carboxylic acid |
|---|---|
| INCHI | InChI=1S/C7H10O4/c8-6(9)5-3-7(4-5)10-1-2-11-7/h5H,1-4H2,(H,8,9) |
| InChIKey | PGWGOPXPTJDZKT-UHFFFAOYSA-N |
| Smiles | C1COC2(O1)CC(C2)C(=O)O |
| Isomeric SMILES | C1COC2(O1)CC(C2)C(=O)O |
| Molecular Weight | 158.153 |
| Reaxy-Rn | 28161565 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=28161565&ln= |
| Molecular Weight | 158.150 g/mol |
|---|---|
| XLogP3 | -0.300 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 158.058 Da |
| Monoisotopic Mass | 158.058 Da |
| Topological Polar Surface Area | 55.800 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 175.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |