Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D590615-1g
|
1g |
3
|
$109.90
|
|
|
D590615-5g
|
5g |
2
|
$429.90
|
|
| Synonyms | SCHEMBL5007880 | 5,7-dioxa-6 | 5,7-Dioxa-6-thiaspiro[2.5]octane6-oxide | 5,7-dioxa-6-thia-spiro[2.5]octane 6-oxide | 5,7-Dioxa-6-thiaspiro[2.5]octane 6-oxide | DTXSID701008957 | 1,1-Cyclopropane dimethanol cyclic sulphate | AISMUYPWEMPRTF-UHFFFAOYSA-N | 5 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C,Desiccated |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Dioxathiolanes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dioxathiolanes |
| Alternative Parents | Sulfite esters Oxacyclic compounds Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Dioxathiolane - Sulfite ester - Oxacycle - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as dioxathiolanes. These are organic heterocyclic compounds containing a dioxathiolane, with a structure consisting of a five-membered saturated ring with one sulfur atom, two oxygen atoms, and two carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5,7-dioxa-6λ4-thiaspiro[2.5]octane 6-oxide |
|---|---|
| INCHI | InChI=1S/C5H8O3S/c6-9-7-3-5(1-2-5)4-8-9/h1-4H2 |
| InChIKey | AISMUYPWEMPRTF-UHFFFAOYSA-N |
| Smiles | C1CC12COS(=O)OC2 |
| Isomeric SMILES | C1CC12COS(=O)OC2 |
| Molecular Weight | 148.18 |
| Reaxy-Rn | 2516901 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2516901&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Nov 23, 2023 | D590615 | |
| Certificate of Analysis | Nov 23, 2023 | D590615 | |
| Certificate of Analysis | Nov 23, 2023 | D590615 | |
| Certificate of Analysis | Nov 23, 2023 | D590615 |
| Molecular Weight | 148.180 g/mol |
|---|---|
| XLogP3 | 0.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 148.019 Da |
| Monoisotopic Mass | 148.019 Da |
| Topological Polar Surface Area | 54.700 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 140.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |