Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T194259-50mg
|
50mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$544.90
|
|
Discover 5,6,7,8-Tetrahydro-1,6-naphthyridin-3-ol hydrochloride by Aladdin Scientific in 95% for only $544.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 5,6,7,8-tetrahydro-1,6-naphthyridin-3-ol hydrochloride | 625098-88-6 | 5,6,7,8-tetrahydro-1,6-naphthyridin-3-ol;hydrochloride | 3-HYDROXY-5,6,7,8-TETRAHYDRO-1,6-NAPHTHYRIDINE HCL | 5,6,7,8-Tetrahydro-1,6-naphthyridin-3-ol, HCl | 5,6,7,8-Tetrahydro-1,6-naphthyridin- |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazanaphthalenes |
| Subclass | Naphthyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Naphthyridines |
| Alternative Parents | Hydroxypyridines Aralkylamines Heteroaromatic compounds Dialkylamines Azacyclic compounds Organooxygen compounds Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Naphthyridine - Hydroxypyridine - Aralkylamine - Pyridine - Heteroaromatic compound - Secondary aliphatic amine - Azacycle - Secondary amine - Amine - Hydrochloride - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as naphthyridines. These are compounds containing a naphthyridine moiety, a naphthalene in which a carbon atom has been replaced by a nitrogen in each of the two rings. The naphthyridine skeleton can also be described as an assembly two fused pyridine rings, which do not share their nitrogen atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5,6,7,8-tetrahydro-1,6-naphthyridin-3-ol;hydrochloride |
|---|---|
| INCHI | InChI=1S/C8H10N2O.ClH/c11-7-3-6-4-9-2-1-8(6)10-5-7;/h3,5,9,11H,1-2,4H2;1H |
| InChIKey | NLQFKDIAWPZSQQ-UHFFFAOYSA-N |
| Smiles | C1CNCC2=C1N=CC(=C2)O.Cl |
| Isomeric SMILES | C1CNCC2=C1N=CC(=C2)O.Cl |
| PubChem CID | 45789763 |
| Molecular Weight | 186.64 |
| Molecular Weight | 186.640 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 186.056 Da |
| Monoisotopic Mass | 186.056 Da |
| Topological Polar Surface Area | 45.200 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 140.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |