Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C300073-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$962.90
|
|
| Synonyms | 18527-31-6 | 5-(4-Chlorophenylthiomethyl)Tetrazole | 5-[(4-chlorophenyl)sulfanylmethyl]-2H-tetrazole | 5-{[(4-chlorophenyl)sulfanyl]methyl}-1H-1,2,3,4-tetrazole | 5-[[(4-chlorophenyl)thio]methyl]-2H-tetrazole | 5-((4-chlorophenylthio)methyl)-1H-tetrazole | 5-[(4-chlo |
|---|---|
| Specifications & Purity | ≥90% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organosulfur compounds |
| Class | Thioethers |
| Subclass | Aryl thioethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aryl thioethers |
| Alternative Parents | Thiophenol ethers Chlorobenzenes Alkylarylthioethers Aryl chlorides Tetrazoles Heteroaromatic compounds Sulfenyl compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Thiophenol ether - Aryl thioether - Chlorobenzene - Halobenzene - Alkylarylthioether - Aryl halide - Benzenoid - Monocyclic benzene moiety - Aryl chloride - Heteroaromatic compound - Azole - Tetrazole - Azacycle - Organoheterocyclic compound - Sulfenyl compound - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organohalogen compound - Organochloride - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aryl thioethers. These are organosulfur compounds containing a thioether group that is substituted by an aryl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5-[(4-chlorophenyl)sulfanylmethyl]-2H-tetrazole |
|---|---|
| INCHI | InChI=1S/C8H7ClN4S/c9-6-1-3-7(4-2-6)14-5-8-10-12-13-11-8/h1-4H,5H2,(H,10,11,12,13) |
| InChIKey | CHUZWYSHNLSTHB-UHFFFAOYSA-N |
| Smiles | C1=CC(=CC=C1SCC2=NNN=N2)Cl |
| Isomeric SMILES | C1=CC(=CC=C1SCC2=NNN=N2)Cl |
| Molecular Weight | 226.69 |
| Reaxy-Rn | 44332584 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=44332584&ln= |
| Molecular Weight | 226.690 g/mol |
|---|---|
| XLogP3 | 2.100 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 226.008 Da |
| Monoisotopic Mass | 226.008 Da |
| Topological Polar Surface Area | 79.800 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 175.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |