Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
R177234-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$184.90
|
|
Discover 5-[(2R)-pyrrolidin-2-yl]-2H-1,2,3,4-tetrazole by Aladdin Scientific in 97% for only $184.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 702700-79-6 | (R)-5-(PYRROLIDIN-2-YL)-1H-TETRAZOLE | 5-[(2R)-pyrrolidin-2-yl]-2H-1,2,3,4-tetrazole | 1H-Tetrazole, 5-(2R)-2-pyrrolidinyl- | 5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole | MFCD10000886 | SCHEMBL2994601 | DTXSID20466427 | CDB70079 | AKOS006376229 | AKOS024255828 | (R)-5 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aralkylamines |
| Alternative Parents | Tetrazoles Pyrrolidines Heteroaromatic compounds Dialkylamines Azacyclic compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aralkylamine - Heteroaromatic compound - Tetrazole - Pyrrolidine - Azole - Azacycle - Organoheterocyclic compound - Secondary amine - Secondary aliphatic amine - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aralkylamines. These are alkylamines in which the alkyl group is substituted at one carbon atom by an aromatic hydrocarbyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5-[(2R)-pyrrolidin-2-yl]-2H-tetrazole |
|---|---|
| INCHI | InChI=1S/C5H9N5/c1-2-4(6-3-1)5-7-9-10-8-5/h4,6H,1-3H2,(H,7,8,9,10)/t4-/m1/s1 |
| InChIKey | XUHYQIQIENDJER-SCSAIBSYSA-N |
| Smiles | C1CC(NC1)C2=NNN=N2 |
| Isomeric SMILES | C1C[C@@H](NC1)C2=NNN=N2 |
| Molecular Weight | 139.1585 |
| Reaxy-Rn | 52462407 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=52462407&ln= |
| Molecular Weight | 139.160 g/mol |
|---|---|
| XLogP3 | -0.600 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 139.086 Da |
| Monoisotopic Mass | 139.086 Da |
| Topological Polar Surface Area | 66.500 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 117.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |