Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P171065-25mg
|
25mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$410.90
|
|
| Synonyms | 57603-82-4 | 5-(Pyrimidin-2-ylsulfanyl)-furan-2-carbaldehyde | 5-(Pyrimidin-2-ylthio)furan-2-carbaldehyde | 5-pyrimidin-2-ylsulfanylfuran-2-carbaldehyde | 5-(pyrimidin-2-ylthio)-2-furaldehyde | 5-(pyrimidin-2-ylsulfanyl)furan-2-carbaldehyde | 5-(2-pyrimidinylsulfanyl |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organosulfur compounds |
| Class | Thioethers |
| Subclass | Aryl thioethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Diarylthioethers |
| Alternative Parents | Aryl-aldehydes Pyrimidines and pyrimidine derivatives Heteroaromatic compounds Furans Sulfenyl compounds Oxacyclic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Diarylthioether - Aryl-aldehyde - Pyrimidine - Furan - Heteroaromatic compound - Sulfenyl compound - Oxacycle - Azacycle - Organoheterocyclic compound - Aldehyde - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as diarylthioethers. These are organosulfur compounds containing a thioether group that is substituted by two aryl groups. |
| External Descriptors | Not available |
|
|
|
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | 5-pyrimidin-2-ylsulfanylfuran-2-carbaldehyde |
|---|---|
| INCHI | InChI=1S/C9H6N2O2S/c12-6-7-2-3-8(13-7)14-9-10-4-1-5-11-9/h1-6H |
| InChIKey | BVGQOPQJOBCDBN-UHFFFAOYSA-N |
| Smiles | C1=CN=C(N=C1)SC2=CC=C(O2)C=O |
| Isomeric SMILES | C1=CN=C(N=C1)SC2=CC=C(O2)C=O |
| PubChem CID | 1112170 |
| Molecular Weight | 206.224 |
| Molecular Weight | 206.220 g/mol |
|---|---|
| XLogP3 | 1.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Exact Mass | 206.015 Da |
| Monoisotopic Mass | 206.015 Da |
| Topological Polar Surface Area | 81.300 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 197.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |