Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T168926-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$139.90
|
|
Discover 4-(Trifluoromethylthio)phenyl isocyanate by Aladdin Scientific in 98% for only $139.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4-(Trifluoromethylthio)phenyl isocyanate, 98% | 4-trifluoromethylsulfanylphenyl isocyanate | FT-0616956 | 4-(Trifluoromethylthio)phenyl isocyanate | SCHEMBL1020679 | STL556922 | 4-(trifluoromethylthio) phenylisocyanate | 4-(trifluoromethyl)thiophenyl isoc |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organosulfur compounds |
| Class | Thioethers |
| Subclass | Aryl thioethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aryl thioethers |
| Alternative Parents | Thiophenol ethers Alkylarylthioethers Benzene and substituted derivatives Trihalomethanes Isocyanates Sulfenyl compounds Propargyl-type 1,3-dipolar organic compounds Organopnictogen compounds Organooxygen compounds Organofluorides Organic oxides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Aryl thioether - Thiophenol ether - Alkylarylthioether - Monocyclic benzene moiety - Benzenoid - Isocyanate - Trihalomethane - Sulfenyl compound - Propargyl-type 1,3-dipolar organic compound - Organic 1,3-dipolar compound - Alkyl fluoride - Hydrocarbon derivative - Halomethane - Organic oxide - Organopnictogen compound - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Organic oxygen compound - Organic nitrogen compound - Alkyl halide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aryl thioethers. These are organosulfur compounds containing a thioether group that is substituted by an aryl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-isocyanato-4-(trifluoromethylsulfanyl)benzene |
|---|---|
| INCHI | InChI=1S/C8H4F3NOS/c9-8(10,11)14-7-3-1-6(2-4-7)12-5-13/h1-4H |
| InChIKey | NYQSIHZNEJCZKX-UHFFFAOYSA-N |
| Smiles | C1=CC(=CC=C1N=C=O)SC(F)(F)F |
| Isomeric SMILES | C1=CC(=CC=C1N=C=O)SC(F)(F)F |
| WGK Germany | 3 |
| PubChem CID | 2733392 |
| Molecular Weight | 219.18 |
| Flash Point(°F) | 203 °F |
|---|---|
| Flash Point(°C) | 95 °C |
| Molecular Weight | 219.190 g/mol |
| XLogP3 | 4.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 2 |
| Exact Mass | 218.997 Da |
| Monoisotopic Mass | 218.997 Da |
| Topological Polar Surface Area | 54.700 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 229.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |