Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T433177-100ml
|
100ml |
1
|
$299.90
|
|
| Synonyms | magnesium;tert-butylbenzene;bromide | YECFWFOEQLAVNH-UHFFFAOYSA-M | (4-tert-butylphenyl)magnesium bromide | 4-tert.-butylphenylmagnesium bromide | 4-tert-butylphenyhnagnesium bromide | 4-t-butylphenylmagnesium bromide | Magnesium, bromo[4-(1,1-dimethyleth |
|---|---|
| Specifications & Purity | 0.5 M in THF |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Phenylpropanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpropanes |
| Alternative Parents | Organic metal halides Organic metal bromide salts Organic bromide salts Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenylpropane - Organic metal halide - Organic metal bromide salt - Hydrocarbon derivative - Organic bromide salt - Organic salt - Organic cation - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylpropanes. These are organic compounds containing a phenylpropane moiety. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | magnesium;tert-butylbenzene;bromide |
|---|---|
| INCHI | InChI=1S/C10H13.BrH.Mg/c1-10(2,3)9-7-5-4-6-8-9;;/h5-8H,1-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | JFWSITPEDQPZNZ-UHFFFAOYSA-M |
| Smiles | CC(C)(C)C1=CC=[C-]C=C1.[Mg+2].[Br-] |
| Isomeric SMILES | CC(C)(C)C1=CC=[C-]C=C1.[Mg+2].[Br-] |
| WGK Germany | 3 |
| UN Number | 2924 |
| Packing Group | II |
| Molecular Weight | 237.42 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Feb 25, 2025 | T433177 |
| Flash Point(°F) | 1.4 °F |
|---|---|
| Flash Point(°C) | -17 °C |
| Boil Point(°C) | 65-67 °C/760 mmHg |
| Molecular Weight | 237.420 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 236.005 Da |
| Monoisotopic Mass | 236.005 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 190.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |