Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N290706-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$794.90
|
|
| Synonyms | 159191-44-3 | 4-(N,N-DIBENZYLAMINO)PHENYLBORONIC ACID | (4-(Dibenzylamino)phenyl)boronic acid | [4-(Dibenzylamino)phenyl]boronic acid | 4-(DIBENZYLAMINO)PHENYLBORONIC ACID | 4-(Dibenzylamino)benzene boronic acid | 4-(N,N-Dibenzylamino)phenylboronicacid | SCHEMBL2320409 |
|---|---|
| Specifications & Purity | ≥97% |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Phenylmethylamines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylbenzamines |
| Alternative Parents | Dialkylarylamines Benzylamines Aniline and substituted anilines Aralkylamines Boronic acids Organic metalloid salts Organometalloid compounds Organic oxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenylbenzamine - Benzylamine - Tertiary aliphatic/aromatic amine - Dialkylarylamine - Aniline or substituted anilines - Aralkylamine - Boronic acid derivative - Boronic acid - Tertiary amine - Organic metalloid salt - Organic oxygen compound - Organonitrogen compound - Organic metalloid moeity - Amine - Organic nitrogen compound - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylbenzamines. These are aromatic compounds consisting of a benzyl group that is N-linked to a benzamine. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | [4-(dibenzylamino)phenyl]boronic acid |
|---|---|
| INCHI | InChI=1S/C20H20BNO2/c23-21(24)19-11-13-20(14-12-19)22(15-17-7-3-1-4-8-17)16-18-9-5-2-6-10-18/h1-14,23-24H,15-16H2 |
| InChIKey | KLGQJKOCSXZOBV-UHFFFAOYSA-N |
| Smiles | B(C1=CC=C(C=C1)N(CC2=CC=CC=C2)CC3=CC=CC=C3)(O)O |
| Isomeric SMILES | B(C1=CC=C(C=C1)N(CC2=CC=CC=C2)CC3=CC=CC=C3)(O)O |
| Molecular Weight | 317.2 |
| Reaxy-Rn | 22001588 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=22001588&ln= |
| Molecular Weight | 317.200 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 6 |
| Exact Mass | 317.159 Da |
| Monoisotopic Mass | 317.159 Da |
| Topological Polar Surface Area | 43.700 Ų |
| Heavy Atom Count | 24 |
| Formal Charge | 0 |
| Complexity | 326.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |