Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M177200-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$701.90
|
|
| Synonyms | 4-METHYLTETRAHYDRO-2H-PYRAN-4-AMINE | 693245-65-7 | 4-methyloxan-4-amine | 4-amino-4-methyltetrahydropyran | MFCD11977350 | 4-methyl-4-oxanamine | 4-AMINO-4-METHYLTETRAHYDRO-4H-PYRAN | SCHEMBL56303 | CHEMBL4556238 | DTXSID50593770 | HECZPOCJWCHBHK-UHFFFAOYSA-N | AMY34985 | AKOS0 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Oxanes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Oxanes |
| Alternative Parents | Oxacyclic compounds Dialkyl ethers Organopnictogen compounds Monoalkylamines Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Oxane - Oxacycle - Ether - Dialkyl ether - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Primary amine - Organooxygen compound - Organonitrogen compound - Primary aliphatic amine - Amine - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as oxanes. These are compounds containing an oxane (tetrahydropyran) ring, which is a six-member saturated aliphatic heterocycle with one oxygen atom and five carbon atoms. |
| External Descriptors | Not available |
|
|
|
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | 4-methyloxan-4-amine |
|---|---|
| INCHI | InChI=1S/C6H13NO/c1-6(7)2-4-8-5-3-6/h2-5,7H2,1H3 |
| InChIKey | HECZPOCJWCHBHK-UHFFFAOYSA-N |
| Smiles | CC1(CCOCC1)N |
| Isomeric SMILES | CC1(CCOCC1)N |
| Molecular Weight | 115.176 |
| Reaxy-Rn | 11463579 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=11463579&ln= |
| Molecular Weight | 115.170 g/mol |
|---|---|
| XLogP3 | -0.100 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 115.1 Da |
| Monoisotopic Mass | 115.1 Da |
| Topological Polar Surface Area | 35.300 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 76.600 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |