Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
I169498-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$42.90
|
|
|
I169498-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$193.90
|
|
Discover 4-Iodo-1-isopropyl-1H-pyrazole by Aladdin Scientific in for only $42.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4-Iodo-1-isopropyl-1H-pyrazole | 313350-82-2 | 4-Iodo-1-isopropylpyrazole | 4-iodo-1-propan-2-ylpyrazole | 4-Iodo-1-(propan-2-yl)-1H-pyrazole | MFCD11867882 | 1H-Pyrazole, 4-iodo-1-(1-methylethyl)- | SCHEMBL1365662 | DTXSID90620574 | CFXNVDUEBJYAAZ-UHFFFAOYSA-N | STL584477 | A |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Class | Aryl halides |
| Subclass | Aryl iodides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aryl iodides |
| Alternative Parents | Pyrazoles Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organoiodides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aryl iodide - Heteroaromatic compound - Pyrazole - Azole - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Organoiodide - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aryl iodides. These are organic compounds containing the acyl iodide functional group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-iodo-1-propan-2-ylpyrazole |
|---|---|
| INCHI | InChI=1S/C6H9IN2/c1-5(2)9-4-6(7)3-8-9/h3-5H,1-2H3 |
| InChIKey | CFXNVDUEBJYAAZ-UHFFFAOYSA-N |
| Smiles | CC(C)N1C=C(C=N1)I |
| Isomeric SMILES | CC(C)N1C=C(C=N1)I |
| Molecular Weight | 236.05 |
| Reaxy-Rn | 9254430 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=9254430&ln= |
| Molecular Weight | 236.050 g/mol |
|---|---|
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | 235.981 Da |
| Monoisotopic Mass | 235.981 Da |
| Topological Polar Surface Area | 17.800 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 95.100 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |