Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
H169182-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$157.90
|
|
|
H169182-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$650.90
|
|
Discover 4-Hydroxy-7-methoxy-1H-quinolin-2-one by Aladdin Scientific in for only $157.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4-Hydroxy-7-methoxy-1H-quinolin-2-one | 27037-34-9 | 4-hydroxy-7-methoxyquinolin-2(1H)-one | 2(1H)-Quinolinone, 4-hydroxy-7-methoxy- | 7-Methoxyquinoline-2,4-diol | 2-Hydroxy-7-methoxyquinolin-4(1H)-one | 4-hydroxy-7-methoxy-1,2-dihydroquinolin-2-one | SCHEMBL743131 | DT |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinolines and derivatives |
| Subclass | Quinolones and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Hydroxyquinolones |
| Alternative Parents | Hydroxyquinolines Hydroquinolones Hydroquinolines Anisoles Pyridinones Hydroxypyridines Alkyl aryl ethers Vinylogous acids Heteroaromatic compounds Lactams Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Hydroxyquinolone - Dihydroquinolone - Hydroxyquinoline - Dihydroquinoline - Anisole - Alkyl aryl ether - Hydroxypyridine - Pyridinone - Pyridine - Benzenoid - Heteroaromatic compound - Vinylogous acid - Lactam - Azacycle - Ether - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as hydroxyquinolones. These are compounds containing a quinoline moiety bearing a hydroxyl group and a ketone. Quinoline or benzo[b]pyridine is a bicyclic compound that consists of benzene fused to a pyridine. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-hydroxy-7-methoxy-1H-quinolin-2-one |
|---|---|
| INCHI | InChI=1S/C10H9NO3/c1-14-6-2-3-7-8(4-6)11-10(13)5-9(7)12/h2-5H,1H3,(H2,11,12,13) |
| InChIKey | RUWKOLGTLOFEMK-UHFFFAOYSA-N |
| Smiles | COC1=CC2=C(C=C1)C(=CC(=O)N2)O |
| Isomeric SMILES | COC1=CC2=C(C=C1)C(=CC(=O)N2)O |
| Molecular Weight | 191.18 |
| Reaxy-Rn | 1459304 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1459304&ln= |
| Molecular Weight | 191.180 g/mol |
|---|---|
| XLogP3 | 0.700 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 191.058 Da |
| Monoisotopic Mass | 191.058 Da |
| Topological Polar Surface Area | 58.600 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 275.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |