Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
F168766-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$35.90
|
|
Discover 4-Fluorophenylboronic acid neopentylglycol ester by Aladdin Scientific in 97% for only $35.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-(4-Fluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane | 225916-39-2 | 4-Fluorophenylboronic acid neopentylglycol ester | 4-Fluorophenylboronic acid, neopentyl ester | SCHEMBL1136930 | DTXSID90452150 | GWWSSPCPSWVJRZ-UHFFFAOYSA-N | MFCD05663850 | AKOS004113989 | AB21949 | AS-30 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fluorobenzenes |
| Alternative Parents | Aryl fluorides Boronic acid esters Oxacyclic compounds Organic metalloid salts Organooxygen compounds Organometalloid compounds Organofluorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Fluorobenzene - Aryl halide - Aryl fluoride - Boronic acid ester - Boronic acid derivative - Oxacycle - Organic metalloid salt - Organoheterocyclic compound - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Organofluoride - Organic metalloid moeity - Organohalogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as fluorobenzenes. These are compounds containing one or more fluorine atoms attached to a benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-(4-fluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
|---|---|
| INCHI | InChI=1S/C11H14BFO2/c1-11(2)7-14-12(15-8-11)9-3-5-10(13)6-4-9/h3-6H,7-8H2,1-2H3 |
| InChIKey | GWWSSPCPSWVJRZ-UHFFFAOYSA-N |
| Smiles | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)F |
| Isomeric SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)F |
| WGK Germany | 3 |
| Molecular Weight | 208.04 |
| Reaxy-Rn | 8257216 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=8257216&ln= |
| Molecular Weight | 208.040 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 208.107 Da |
| Monoisotopic Mass | 208.107 Da |
| Topological Polar Surface Area | 18.500 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 205.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |