Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
F302151-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$79.90
|
|
| Synonyms | (4-Fluorobenzyl)hydrazine hydrochloride | 1059626-05-9 | (4-FLUOROBENZYL)HYDRAZINE HCL | (4-fluorophenyl)methylhydrazine;hydrochloride | 4-Fluorobenzylhydrazine hydrochloride | (4-fluorophenyl)methylhydrazine hydrochloride | (4-Fluorobenzyl)hydrazinehydrochloride | [(4 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fluorobenzenes |
| Alternative Parents | Aryl fluorides Alkylhydrazines Organofluorides Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Fluorobenzene - Aryl halide - Aryl fluoride - Alkylhydrazine - Organic nitrogen compound - Hydrocarbon derivative - Hydrochloride - Organonitrogen compound - Organofluoride - Organohalogen compound - Hydrazine derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as fluorobenzenes. These are compounds containing one or more fluorine atoms attached to a benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (4-fluorophenyl)methylhydrazine;hydrochloride |
|---|---|
| INCHI | InChI=1S/C7H9FN2.ClH/c8-7-3-1-6(2-4-7)5-10-9;/h1-4,10H,5,9H2;1H |
| InChIKey | CQWGDVFENPNFJH-UHFFFAOYSA-N |
| Smiles | C1=CC(=CC=C1CNN)F.Cl |
| Isomeric SMILES | C1=CC(=CC=C1CNN)F.Cl |
| Molecular Weight | 176.62 |
| Molecular Weight | 176.620 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 176.052 Da |
| Monoisotopic Mass | 176.052 Da |
| Topological Polar Surface Area | 38.100 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 89.600 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |