Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
F193412-1g
|
1g |
4
|
$63.90
|
|
|
F193412-5g
|
5g |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$221.90
|
|
| Synonyms | 4-fluoro-N,N-diphenylaniline | Benzenamine, 4-fluoro-N,N-diphenyl- | MFCD00983609 | AS-60948 | F1179 | p-fluortriphenylamin | H11888 | AKOS037645475 | SCHEMBL8686283 | 4-Fluoro-n,n-diphenylbenzenamine | InChI=1/C18H14FN/c19-15-11-13-18(14-12-15)20(16-7-3- |
|---|---|
| Specifications & Purity | ≥99% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Tertiary amines |
| Direct Parent | Triarylamines |
| Alternative Parents | Aniline and substituted anilines Fluorobenzenes Aryl fluorides Organopnictogen compounds Organofluorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Tertiary aromatic amine - Aniline or substituted anilines - Halobenzene - Fluorobenzene - Benzenoid - Monocyclic benzene moiety - Aryl halide - Aryl fluoride - Organopnictogen compound - Hydrocarbon derivative - Organofluoride - Organohalogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as triarylamines. These are organic compounds containing a trialkylamine group, characterized by exactly three aryl groups bonded to the amino nitrogen. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504769022 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504769022 |
| IUPAC Name | 4-fluoro-N,N-diphenylaniline |
| INCHI | InChI=1S/C18H14FN/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14H |
| InChIKey | LQDQVCOHANBTIC-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)F |
| Isomeric SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)F |
| Molecular Weight | 263.31 |
| Reaxy-Rn | 2975731 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2975731&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Oct 24, 2023 | F193412 | |
| Certificate of Analysis | Oct 24, 2023 | F193412 | |
| Certificate of Analysis | Jul 26, 2023 | F193412 |
| Boil Point(°C) | 205 °C/15 mmHg |
|---|---|
| Melt Point(°C) | 101 °C |
| Molecular Weight | 263.300 g/mol |
| XLogP3 | 5.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 3 |
| Exact Mass | 263.111 Da |
| Monoisotopic Mass | 263.111 Da |
| Topological Polar Surface Area | 3.200 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 255.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |