Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
F300712-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$103.90
|
|
|
F300712-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$344.90
|
|
Discover 4-Fluoro-3-(trifluoromethyl)phenyl isothiocyanate by Aladdin Scientific in 95% for only $103.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 302912-43-2 | 4-Fluoro-3-(trifluoromethyl)phenyl isothiocyanate | 1-fluoro-4-isothiocyanato-2-(trifluoromethyl)benzene | 4-Fluoro-3-(trifluoromethyl)phenylisothiocyanate | 4-FLUORO-3-TRIFLUOROMETHYLPHENYLISOTHI& | SCHEMBL1435515 | Benzene, 1-fluoro-4-isothiocyanato-2 |
|---|---|
| Specifications & Purity | ≥95% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Trifluoromethylbenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Trifluoromethylbenzenes |
| Alternative Parents | Fluorobenzenes Aryl fluorides Isothiocyanates Propargyl-type 1,3-dipolar organic compounds Organonitrogen compounds Organofluorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Trifluoromethylbenzene - Fluorobenzene - Halobenzene - Aryl fluoride - Aryl halide - Isothiocyanate - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Organohalogen compound - Organosulfur compound - Alkyl halide - Alkyl fluoride - Hydrocarbon derivative - Organic nitrogen compound - Organofluoride - Organonitrogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as trifluoromethylbenzenes. These are organofluorine compounds that contain a benzene ring substituted with one or more trifluoromethyl groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-fluoro-4-isothiocyanato-2-(trifluoromethyl)benzene |
|---|---|
| INCHI | InChI=1S/C8H3F4NS/c9-7-2-1-5(13-4-14)3-6(7)8(10,11)12/h1-3H |
| InChIKey | QBKIGUJFPYMZPS-UHFFFAOYSA-N |
| Smiles | C1=CC(=C(C=C1N=C=S)C(F)(F)F)F |
| Isomeric SMILES | C1=CC(=C(C=C1N=C=S)C(F)(F)F)F |
| WGK Germany | 3 |
| Molecular Weight | 221.17 |
| Reaxy-Rn | 18988412 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=18988412&ln= |
| Flash Point(°F) | 224.6 °F |
|---|---|
| Flash Point(°C) | 107 °C |
| Molecular Weight | 221.180 g/mol |
| XLogP3 | 4.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 1 |
| Exact Mass | 220.992 Da |
| Monoisotopic Mass | 220.992 Da |
| Topological Polar Surface Area | 44.500 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 246.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |